About 5-[[4-(pentafluoro-λ6-sulfanyl)phenyl]methylidene]-2-thiomorpholin-4-yl-1,3-thiazol-4-one
5-[[4-(pentafluoro-λ6-sulfanyl)phenyl]methylidene]-2-thiomorpholin-4-yl-1,3-thiazol-4-one (PubChem CID 87686596) has the molecular formula C14H13F5N2OS3
and a molecular weight of 416.46 g/mol. Its IUPAC name is 5-[[4-(pentafluoro-λ6-sulfanyl)phenyl]methylidene]-2-thiomorpholin-4-yl-1,3-thiazol-4-one.
Molecular Properties
| Compound Name | 5-[[4-(pentafluoro-λ6-sulfanyl)phenyl]methylidene]-2-thiomorpholin-4-yl-1,3-thiazol-4-one |
| PubChem CID | 87686596 |
| Molecular Formula | C14H13F5N2OS3 |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.01 |
| IUPAC Name | 5-[[4-(pentafluoro-λ6-sulfanyl)phenyl]methylidene]-2-thiomorpholin-4-yl-1,3-thiazol-4-one |
| SMILES | O=C1N=C(N2CCSCC2)SC1=Cc1ccc(S(F)(F)(F)(F)F)cc1 |
| InChI | InChI=1S/C14H13F5N2OS3/c15-25(16,17,18,19)11-3-1-10(2-4-11)9-12-13(22)20-14(24-12)21-5-7-23-8-6-21/h1-4,9H,5-8H2 |
| InChIKey | WRKUWCJOTQIJKV-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-[[4-(pentafluoro-λ6-sulfanyl)phenyl]methylidene]-2-thiomorpholin-4-yl-1,3-thiazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[4-(pentafluoro-λ6-sulfanyl)phenyl]methylidene]-2-thiomorpholin-4-yl-1,3-thiazol-4-one?
The IUPAC name of 5-[[4-(pentafluoro-λ6-sulfanyl)phenyl]methylidene]-2-thiomorpholin-4-yl-1,3-thiazol-4-one (CID 87686596) is 5-[[4-(pentafluoro-λ6-sulfanyl)phenyl]methylidene]-2-thiomorpholin-4-yl-1,3-thiazol-4-one.
What is the SMILES notation for 5-[[4-(pentafluoro-λ6-sulfanyl)phenyl]methylidene]-2-thiomorpholin-4-yl-1,3-thiazol-4-one?
The canonical SMILES for 5-[[4-(pentafluoro-λ6-sulfanyl)phenyl]methylidene]-2-thiomorpholin-4-yl-1,3-thiazol-4-one is O=C1N=C(N2CCSCC2)SC1=Cc1ccc(S(F)(F)(F)(F)F)cc1.
What is the InChIKey of 5-[[4-(pentafluoro-λ6-sulfanyl)phenyl]methylidene]-2-thiomorpholin-4-yl-1,3-thiazol-4-one?
The InChIKey is WRKUWCJOTQIJKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13F5N2OS3/c15-25(16,17,18,19)11-3-1-10(2-4-11)9-12-13(22)20-14(24-12)21-5-7-23-8-6-21/h1-4,9H,5-8H2.
What are the key properties of 5-[[4-(pentafluoro-λ6-sulfanyl)phenyl]methylidene]-2-thiomorpholin-4-yl-1,3-thiazol-4-one?
5-[[4-(pentafluoro-λ6-sulfanyl)phenyl]methylidene]-2-thiomorpholin-4-yl-1,3-thiazol-4-one has a molecular weight of 416.46 g/mol, XLogP of 5.36, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[4-(pentafluoro-λ6-sulfanyl)phenyl]methylidene]-2-thiomorpholin-4-yl-1,3-thiazol-4-one is sourced from PubChem (CID 87686596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).