C14H13F5N2OS3 — CID 87686596
5-[[4-(pentafluoro-λ6-sulfanyl)phenyl]methylidene]-2-thiomorpholin-4-yl-1,3-thiazol-4-one (PubChem CID 87686596) has the molecular formula C14H13F5N2OS3 and a molecular weight of 416.46 g/mol. Its IUPAC name is 5-[[4-(pentafluoro-λ6-sulfanyl)phenyl]methylidene]-2-thiomorpholin-4-yl-1,3-thiazol-4-one.
| Compound Name | 5-[[4-(pentafluoro-λ6-sulfanyl)phenyl]methylidene]-2-thiomorpholin-4-yl-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 87686596 |
| Molecular Formula | C14H13F5N2OS3 |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.01 |
| IUPAC Name | 5-[[4-(pentafluoro-λ6-sulfanyl)phenyl]methylidene]-2-thiomorpholin-4-yl-1,3-thiazol-4-one |
| SMILES | O=C1N=C(N2CCSCC2)SC1=Cc1ccc(S(F)(F)(F)(F)F)cc1 |
| InChI | InChI=1S/C14H13F5N2OS3/c15-25(16,17,18,19)11-3-1-10(2-4-11)9-12-13(22)20-14(24-12)21-5-7-23-8-6-21/h1-4,9H,5-8H2 |
| InChIKey | WRKUWCJOTQIJKV-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|