C26H32N2O2 — CID 87686728
2,5-dicyclopentyl-4,6-bis(furan-2-ylmethyl)benzene-1,3-diamine (PubChem CID 87686728) has the molecular formula C26H32N2O2 and a molecular weight of 404.55 g/mol. Its IUPAC name is 2,5-dicyclopentyl-4,6-bis(furan-2-ylmethyl)benzene-1,3-diamine.
| Compound Name | 2,5-dicyclopentyl-4,6-bis(furan-2-ylmethyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 87686728 |
| Molecular Formula | C26H32N2O2 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | 2,5-dicyclopentyl-4,6-bis(furan-2-ylmethyl)benzene-1,3-diamine |
| SMILES | Nc1c(Cc2ccco2)c(C2CCCC2)c(Cc2ccco2)c(N)c1C1CCCC1 |
| InChI | InChI=1S/C26H32N2O2/c27-25-21(15-19-11-5-13-29-19)23(17-7-1-2-8-17)22(16-20-12-6-14-30-20)26(28)24(25)18-9-3-4-10-18/h5-6,11-14,17-18H,1-4,7-10,15-16,27-28H2 |
| InChIKey | HSCMXEBDJAZZMB-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 78.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|