C48H48F2N12O4S2 — CID 87686969
1,2-bis[1-(1-benzylpiperidin-4-yl)pyrazolo[5,4-d]pyrimidin-4-yl]-1,2-bis(2-fluoro-4-methylsulfonylphenyl)hydrazine (PubChem CID 87686969) has the molecular formula C48H48F2N12O4S2 and a molecular weight of 959.12 g/mol. Its IUPAC name is 1,2-bis[1-(1-benzylpiperidin-4-yl)pyrazolo[5,4-d]pyrimidin-4-yl]-1,2-bis(2-fluoro-4-methylsulfonylphenyl)hydrazine.
| Compound Name | 1,2-bis[1-(1-benzylpiperidin-4-yl)pyrazolo[5,4-d]pyrimidin-4-yl]-1,2-bis(2-fluoro-4-methylsulfonylphenyl)hydrazine |
|---|---|
| PubChem CID | 87686969 |
| Molecular Formula | C48H48F2N12O4S2 |
| Molecular Weight | 959.12 g/mol |
| Exact Mass | 958.33 |
| IUPAC Name | 1,2-bis[1-(1-benzylpiperidin-4-yl)pyrazolo[5,4-d]pyrimidin-4-yl]-1,2-bis(2-fluoro-4-methylsulfonylphenyl)hydrazine |
| SMILES | CS(=O)(=O)c1ccc(N(c2ncnc3c2cnn3C2CCN(Cc3ccccc3)CC2)N(c2ccc(S(C)(=O)=O)cc2F)c2ncnc3c2cnn3C2CCN(Cc3ccccc3)CC2)c(F)c1 |
| InChI | InChI=1S/C48H48F2N12O4S2/c1-67(63,64)37-13-15-43(41(49)25-37)61(47-39-27-55-59(45(39)51-31-53-47)35-17-21-57(22-18-35)29-33-9-5-3-6-10-33)62(44-16-14-38(26-42(44)50)68(2,65)66)48-40-28-56-60(46(40)52-32-54-48)36-19-23-58(24-20-36)30-34-11-7-4-8-12-34/h3-16,25-28,31-32,35-36H,17-24,29-30H2,1-2H3 |
| InChIKey | SWAWLSZRXOJBOR-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 168.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 959.12 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|