About 1-ethyl-1,2-dimethylimidazol-1-ium tetrafluoroborate
1-ethyl-1,2-dimethylimidazol-1-ium tetrafluoroborate (PubChem CID 87687407) has the molecular formula C7H13BF4N2
and a molecular weight of 212.00 g/mol. Its IUPAC name is 1-ethyl-1,2-dimethylimidazol-1-ium tetrafluoroborate.
Molecular Properties
| Compound Name | 1-ethyl-1,2-dimethylimidazol-1-ium tetrafluoroborate |
| PubChem CID | 87687407 |
| Molecular Formula | C7H13BF4N2 |
| Molecular Weight | 212.00 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 1-ethyl-1,2-dimethylimidazol-1-ium tetrafluoroborate |
| SMILES | CC[N+]1(C)C=CN=C1C.F[B-](F)(F)F |
| InChI | InChI=1S/C7H13N2.BF4/c1-4-9(3)6-5-8-7(9)2;2-1(3,4)5/h5-6H,4H2,1-3H3;/q+1;-1 |
| InChIKey | SKJWXZOTKQJVOO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.00 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-1,2-dimethylimidazol-1-ium tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-1,2-dimethylimidazol-1-ium tetrafluoroborate?
The IUPAC name of 1-ethyl-1,2-dimethylimidazol-1-ium tetrafluoroborate (CID 87687407) is 1-ethyl-1,2-dimethylimidazol-1-ium tetrafluoroborate.
What is the SMILES notation for 1-ethyl-1,2-dimethylimidazol-1-ium tetrafluoroborate?
The canonical SMILES for 1-ethyl-1,2-dimethylimidazol-1-ium tetrafluoroborate is CC[N+]1(C)C=CN=C1C.F[B-](F)(F)F.
What is the InChIKey of 1-ethyl-1,2-dimethylimidazol-1-ium tetrafluoroborate?
The InChIKey is SKJWXZOTKQJVOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N2.BF4/c1-4-9(3)6-5-8-7(9)2;2-1(3,4)5/h5-6H,4H2,1-3H3;/q+1;-1.
What are the key properties of 1-ethyl-1,2-dimethylimidazol-1-ium tetrafluoroborate?
1-ethyl-1,2-dimethylimidazol-1-ium tetrafluoroborate has a molecular weight of 212.00 g/mol, XLogP of 2.66, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-1,2-dimethylimidazol-1-ium tetrafluoroborate is sourced from PubChem (CID 87687407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).