About 4-ethyl-1,2-dimethyl-1H-imidazol-1-ium tetrafluoroborate
4-ethyl-1,2-dimethyl-1H-imidazol-1-ium tetrafluoroborate (PubChem CID 87687408) has the molecular formula C7H13BF4N2
and a molecular weight of 212.00 g/mol. Its IUPAC name is 4-ethyl-1,2-dimethyl-1H-imidazol-1-ium tetrafluoroborate.
Molecular Properties
| Compound Name | 4-ethyl-1,2-dimethyl-1H-imidazol-1-ium tetrafluoroborate |
| PubChem CID | 87687408 |
| Molecular Formula | C7H13BF4N2 |
| Molecular Weight | 212.00 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 4-ethyl-1,2-dimethyl-1H-imidazol-1-ium tetrafluoroborate |
| SMILES | CCC1=C[NH+](C)C(C)=N1.F[B-](F)(F)F |
| InChI | InChI=1S/C7H12N2.BF4/c1-4-7-5-9(3)6(2)8-7;2-1(3,4)5/h5H,4H2,1-3H3;/q;-1/p+1 |
| InChIKey | OEVHCPHQDBUARD-UHFFFAOYSA-O |
| XLogP | 1.48 |
| TPSA | 16.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.00 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-1,2-dimethyl-1H-imidazol-1-ium tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-1,2-dimethyl-1H-imidazol-1-ium tetrafluoroborate?
The IUPAC name of 4-ethyl-1,2-dimethyl-1H-imidazol-1-ium tetrafluoroborate (CID 87687408) is 4-ethyl-1,2-dimethyl-1H-imidazol-1-ium tetrafluoroborate.
What is the SMILES notation for 4-ethyl-1,2-dimethyl-1H-imidazol-1-ium tetrafluoroborate?
The canonical SMILES for 4-ethyl-1,2-dimethyl-1H-imidazol-1-ium tetrafluoroborate is CCC1=C[NH+](C)C(C)=N1.F[B-](F)(F)F.
What is the InChIKey of 4-ethyl-1,2-dimethyl-1H-imidazol-1-ium tetrafluoroborate?
The InChIKey is OEVHCPHQDBUARD-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H12N2.BF4/c1-4-7-5-9(3)6(2)8-7;2-1(3,4)5/h5H,4H2,1-3H3;/q;-1/p+1.
What are the key properties of 4-ethyl-1,2-dimethyl-1H-imidazol-1-ium tetrafluoroborate?
4-ethyl-1,2-dimethyl-1H-imidazol-1-ium tetrafluoroborate has a molecular weight of 212.00 g/mol, XLogP of 1.48, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-1,2-dimethyl-1H-imidazol-1-ium tetrafluoroborate is sourced from PubChem (CID 87687408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).