C22H28ClN3O6S — CID 87687516
[3-benzyl-2-[[2-chloro-6-[methylsulfonyl(propyl)amino]-4-pyridinyl]methoxy]oxolan-3-yl]carbamic acid (PubChem CID 87687516) has the molecular formula C22H28ClN3O6S and a molecular weight of 498.00 g/mol. Its IUPAC name is [3-benzyl-2-[[2-chloro-6-[methylsulfonyl(propyl)amino]-4-pyridinyl]methoxy]oxolan-3-yl]carbamic acid.
| Compound Name | [3-benzyl-2-[[2-chloro-6-[methylsulfonyl(propyl)amino]-4-pyridinyl]methoxy]oxolan-3-yl]carbamic acid |
|---|---|
| PubChem CID | 87687516 |
| Molecular Formula | C22H28ClN3O6S |
| Molecular Weight | 498.00 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | [3-benzyl-2-[[2-chloro-6-[methylsulfonyl(propyl)amino]-4-pyridinyl]methoxy]oxolan-3-yl]carbamic acid |
| SMILES | CCCN(c1cc(COC2OCCC2(Cc2ccccc2)NC(=O)O)cc(Cl)n1)S(C)(=O)=O |
| InChI | InChI=1S/C22H28ClN3O6S/c1-3-10-26(33(2,29)30)19-13-17(12-18(23)24-19)15-32-20-22(9-11-31-20,25-21(27)28)14-16-7-5-4-6-8-16/h4-8,12-13,20,25H,3,9-11,14-15H2,1-2H3,(H,27,28) |
| InChIKey | UUACDMDJJGWSBJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 118.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.00 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|