C11H18N2O2 — CID 87687882
1,1-diisocyanato-2,2,5-trimethylhexane (PubChem CID 87687882) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 1,1-diisocyanato-2,2,5-trimethylhexane.
| Compound Name | 1,1-diisocyanato-2,2,5-trimethylhexane |
|---|---|
| PubChem CID | 87687882 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 1,1-diisocyanato-2,2,5-trimethylhexane |
| SMILES | CC(C)CCC(C)(C)C(N=C=O)N=C=O |
| InChI | InChI=1S/C11H18N2O2/c1-9(2)5-6-11(3,4)10(12-7-14)13-8-15/h9-10H,5-6H2,1-4H3 |
| InChIKey | XLIIKXRSFVKJEV-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|