About N-methyl-1-nitrosopropane-1,3-diamine
N-methyl-1-nitrosopropane-1,3-diamine (PubChem CID 87688154) has the molecular formula C4H11N3O
and a molecular weight of 117.15 g/mol. Its IUPAC name is N-methyl-1-nitrosopropane-1,3-diamine.
Molecular Properties
| Compound Name | N-methyl-1-nitrosopropane-1,3-diamine |
| PubChem CID | 87688154 |
| Molecular Formula | C4H11N3O |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.09 |
| IUPAC Name | N-methyl-1-nitrosopropane-1,3-diamine |
| SMILES | CNC(CCN)N=O |
| InChI | InChI=1S/C4H11N3O/c1-6-4(7-8)2-3-5/h4,6H,2-3,5H2,1H3 |
| InChIKey | MQWKBKQUIIJFRP-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-methyl-1-nitrosopropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-nitrosopropane-1,3-diamine?
The IUPAC name of N-methyl-1-nitrosopropane-1,3-diamine (CID 87688154) is N-methyl-1-nitrosopropane-1,3-diamine.
What is the SMILES notation for N-methyl-1-nitrosopropane-1,3-diamine?
The canonical SMILES for N-methyl-1-nitrosopropane-1,3-diamine is CNC(CCN)N=O.
What is the InChIKey of N-methyl-1-nitrosopropane-1,3-diamine?
The InChIKey is MQWKBKQUIIJFRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N3O/c1-6-4(7-8)2-3-5/h4,6H,2-3,5H2,1H3.
What are the key properties of N-methyl-1-nitrosopropane-1,3-diamine?
N-methyl-1-nitrosopropane-1,3-diamine has a molecular weight of 117.15 g/mol, XLogP of -0.35, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-nitrosopropane-1,3-diamine is sourced from PubChem (CID 87688154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).