C15H26N4O — CID 87688572
(1E,3Z)-2-(4-morpholin-4-ylpiperidin-1-yl)hexa-1,3,5-triene-1,5-diamine (PubChem CID 87688572) has the molecular formula C15H26N4O and a molecular weight of 278.40 g/mol. Its IUPAC name is (1E,3Z)-2-(4-morpholin-4-ylpiperidin-1-yl)hexa-1,3,5-triene-1,5-diamine.
| Compound Name | (1E,3Z)-2-(4-morpholin-4-ylpiperidin-1-yl)hexa-1,3,5-triene-1,5-diamine |
|---|---|
| PubChem CID | 87688572 |
| Molecular Formula | C15H26N4O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | (1E,3Z)-2-(4-morpholin-4-ylpiperidin-1-yl)hexa-1,3,5-triene-1,5-diamine |
| SMILES | C=C(N)/C=C\C(=C/N)N1CCC(N2CCOCC2)CC1 |
| InChI | InChI=1S/C15H26N4O/c1-13(17)2-3-15(12-16)18-6-4-14(5-7-18)19-8-10-20-11-9-19/h2-3,12,14H,1,4-11,16-17H2/b3-2-,15-12+ |
| InChIKey | MPYKFMVISCJBBN-YCCFYQKASA-N |
| XLogP | 0.61 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|