C13H24N4 — CID 87688619
(1E,3Z)-2-[4-(dimethylamino)piperidin-1-yl]hexa-1,3,5-triene-1,5-diamine (PubChem CID 87688619) has the molecular formula C13H24N4 and a molecular weight of 236.36 g/mol. Its IUPAC name is (1E,3Z)-2-[4-(dimethylamino)piperidin-1-yl]hexa-1,3,5-triene-1,5-diamine.
| Compound Name | (1E,3Z)-2-[4-(dimethylamino)piperidin-1-yl]hexa-1,3,5-triene-1,5-diamine |
|---|---|
| PubChem CID | 87688619 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | (1E,3Z)-2-[4-(dimethylamino)piperidin-1-yl]hexa-1,3,5-triene-1,5-diamine |
| SMILES | C=C(N)/C=C\C(=C/N)N1CCC(N(C)C)CC1 |
| InChI | InChI=1S/C13H24N4/c1-11(15)4-5-13(10-14)17-8-6-12(7-9-17)16(2)3/h4-5,10,12H,1,6-9,14-15H2,2-3H3/b5-4-,13-10+ |
| InChIKey | LKSBTCKGPKBGAM-GNPUEAEQSA-N |
| XLogP | 0.84 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|