About [4-(2,2-difluoroethoxy)-2-(iodomethyl)cyclohexa-1,5-dien-1-yl]methanamine
[4-(2,2-difluoroethoxy)-2-(iodomethyl)cyclohexa-1,5-dien-1-yl]methanamine (PubChem CID 87688740) has the molecular formula C10H14F2INO
and a molecular weight of 329.13 g/mol. Its IUPAC name is [4-(2,2-difluoroethoxy)-2-(iodomethyl)cyclohexa-1,5-dien-1-yl]methanamine.
Molecular Properties
| Compound Name | [4-(2,2-difluoroethoxy)-2-(iodomethyl)cyclohexa-1,5-dien-1-yl]methanamine |
| PubChem CID | 87688740 |
| Molecular Formula | C10H14F2INO |
| Molecular Weight | 329.13 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | [4-(2,2-difluoroethoxy)-2-(iodomethyl)cyclohexa-1,5-dien-1-yl]methanamine |
| SMILES | NCC1=C(CI)CC(OCC(F)F)C=C1 |
| InChI | InChI=1S/C10H14F2INO/c11-10(12)6-15-9-2-1-7(5-14)8(3-9)4-13/h1-2,9-10H,3-6,14H2 |
| InChIKey | JJEVAUAZYOOHOV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.13 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [4-(2,2-difluoroethoxy)-2-(iodomethyl)cyclohexa-1,5-dien-1-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2,2-difluoroethoxy)-2-(iodomethyl)cyclohexa-1,5-dien-1-yl]methanamine?
The IUPAC name of [4-(2,2-difluoroethoxy)-2-(iodomethyl)cyclohexa-1,5-dien-1-yl]methanamine (CID 87688740) is [4-(2,2-difluoroethoxy)-2-(iodomethyl)cyclohexa-1,5-dien-1-yl]methanamine.
What is the SMILES notation for [4-(2,2-difluoroethoxy)-2-(iodomethyl)cyclohexa-1,5-dien-1-yl]methanamine?
The canonical SMILES for [4-(2,2-difluoroethoxy)-2-(iodomethyl)cyclohexa-1,5-dien-1-yl]methanamine is NCC1=C(CI)CC(OCC(F)F)C=C1.
What is the InChIKey of [4-(2,2-difluoroethoxy)-2-(iodomethyl)cyclohexa-1,5-dien-1-yl]methanamine?
The InChIKey is JJEVAUAZYOOHOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F2INO/c11-10(12)6-15-9-2-1-7(5-14)8(3-9)4-13/h1-2,9-10H,3-6,14H2.
What are the key properties of [4-(2,2-difluoroethoxy)-2-(iodomethyl)cyclohexa-1,5-dien-1-yl]methanamine?
[4-(2,2-difluoroethoxy)-2-(iodomethyl)cyclohexa-1,5-dien-1-yl]methanamine has a molecular weight of 329.13 g/mol, XLogP of 2.29, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2,2-difluoroethoxy)-2-(iodomethyl)cyclohexa-1,5-dien-1-yl]methanamine is sourced from PubChem (CID 87688740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).