About 1-[6-(2,2-difluoroethoxy)-5-(iodomethyl)-3-pyridinyl]ethanamine
1-[6-(2,2-difluoroethoxy)-5-(iodomethyl)-3-pyridinyl]ethanamine (PubChem CID 87688741) has the molecular formula C10H13F2IN2O
and a molecular weight of 342.13 g/mol. Its IUPAC name is 1-[6-(2,2-difluoroethoxy)-5-(iodomethyl)-3-pyridinyl]ethanamine.
Molecular Properties
| Compound Name | 1-[6-(2,2-difluoroethoxy)-5-(iodomethyl)-3-pyridinyl]ethanamine |
| PubChem CID | 87688741 |
| Molecular Formula | C10H13F2IN2O |
| Molecular Weight | 342.13 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | 1-[6-(2,2-difluoroethoxy)-5-(iodomethyl)-3-pyridinyl]ethanamine |
| SMILES | CC(N)c1cnc(OCC(F)F)c(CI)c1 |
| InChI | InChI=1S/C10H13F2IN2O/c1-6(14)8-2-7(3-13)10(15-4-8)16-5-9(11)12/h2,4,6,9H,3,5,14H2,1H3 |
| InChIKey | MPFXCSYCPRAWDF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.13 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-[6-(2,2-difluoroethoxy)-5-(iodomethyl)-3-pyridinyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-(2,2-difluoroethoxy)-5-(iodomethyl)-3-pyridinyl]ethanamine?
The IUPAC name of 1-[6-(2,2-difluoroethoxy)-5-(iodomethyl)-3-pyridinyl]ethanamine (CID 87688741) is 1-[6-(2,2-difluoroethoxy)-5-(iodomethyl)-3-pyridinyl]ethanamine.
What is the SMILES notation for 1-[6-(2,2-difluoroethoxy)-5-(iodomethyl)-3-pyridinyl]ethanamine?
The canonical SMILES for 1-[6-(2,2-difluoroethoxy)-5-(iodomethyl)-3-pyridinyl]ethanamine is CC(N)c1cnc(OCC(F)F)c(CI)c1.
What is the InChIKey of 1-[6-(2,2-difluoroethoxy)-5-(iodomethyl)-3-pyridinyl]ethanamine?
The InChIKey is MPFXCSYCPRAWDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13F2IN2O/c1-6(14)8-2-7(3-13)10(15-4-8)16-5-9(11)12/h2,4,6,9H,3,5,14H2,1H3.
What are the key properties of 1-[6-(2,2-difluoroethoxy)-5-(iodomethyl)-3-pyridinyl]ethanamine?
1-[6-(2,2-difluoroethoxy)-5-(iodomethyl)-3-pyridinyl]ethanamine has a molecular weight of 342.13 g/mol, XLogP of 2.68, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-(2,2-difluoroethoxy)-5-(iodomethyl)-3-pyridinyl]ethanamine is sourced from PubChem (CID 87688741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).