About [4-(2,2-difluoroethoxy)-3-fluorocyclohexa-1,5-dien-1-yl]methanamine
[4-(2,2-difluoroethoxy)-3-fluorocyclohexa-1,5-dien-1-yl]methanamine (PubChem CID 87688743) has the molecular formula C9H12F3NO
and a molecular weight of 207.19 g/mol. Its IUPAC name is [4-(2,2-difluoroethoxy)-3-fluorocyclohexa-1,5-dien-1-yl]methanamine.
Molecular Properties
| Compound Name | [4-(2,2-difluoroethoxy)-3-fluorocyclohexa-1,5-dien-1-yl]methanamine |
| PubChem CID | 87688743 |
| Molecular Formula | C9H12F3NO |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | [4-(2,2-difluoroethoxy)-3-fluorocyclohexa-1,5-dien-1-yl]methanamine |
| SMILES | NCC1=CC(F)C(OCC(F)F)C=C1 |
| InChI | InChI=1S/C9H12F3NO/c10-7-3-6(4-13)1-2-8(7)14-5-9(11)12/h1-3,7-9H,4-5,13H2 |
| InChIKey | ATHXFOGLHZBVEP-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [4-(2,2-difluoroethoxy)-3-fluorocyclohexa-1,5-dien-1-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2,2-difluoroethoxy)-3-fluorocyclohexa-1,5-dien-1-yl]methanamine?
The IUPAC name of [4-(2,2-difluoroethoxy)-3-fluorocyclohexa-1,5-dien-1-yl]methanamine (CID 87688743) is [4-(2,2-difluoroethoxy)-3-fluorocyclohexa-1,5-dien-1-yl]methanamine.
What is the SMILES notation for [4-(2,2-difluoroethoxy)-3-fluorocyclohexa-1,5-dien-1-yl]methanamine?
The canonical SMILES for [4-(2,2-difluoroethoxy)-3-fluorocyclohexa-1,5-dien-1-yl]methanamine is NCC1=CC(F)C(OCC(F)F)C=C1.
What is the InChIKey of [4-(2,2-difluoroethoxy)-3-fluorocyclohexa-1,5-dien-1-yl]methanamine?
The InChIKey is ATHXFOGLHZBVEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F3NO/c10-7-3-6(4-13)1-2-8(7)14-5-9(11)12/h1-3,7-9H,4-5,13H2.
What are the key properties of [4-(2,2-difluoroethoxy)-3-fluorocyclohexa-1,5-dien-1-yl]methanamine?
[4-(2,2-difluoroethoxy)-3-fluorocyclohexa-1,5-dien-1-yl]methanamine has a molecular weight of 207.19 g/mol, XLogP of 1.43, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2,2-difluoroethoxy)-3-fluorocyclohexa-1,5-dien-1-yl]methanamine is sourced from PubChem (CID 87688743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).