C11H23N3O — CID 87688928
N-[(E)-2-aminoethylideneamino]-2,2,4,4-tetramethylpentanamide (PubChem CID 87688928) has the molecular formula C11H23N3O and a molecular weight of 213.32 g/mol. Its IUPAC name is N-[(E)-2-aminoethylideneamino]-2,2,4,4-tetramethylpentanamide.
| Compound Name | N-[(E)-2-aminoethylideneamino]-2,2,4,4-tetramethylpentanamide |
|---|---|
| PubChem CID | 87688928 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | N-[(E)-2-aminoethylideneamino]-2,2,4,4-tetramethylpentanamide |
| SMILES | CC(C)(C)CC(C)(C)C(=O)N/N=C/CN |
| InChI | InChI=1S/C11H23N3O/c1-10(2,3)8-11(4,5)9(15)14-13-7-6-12/h7H,6,8,12H2,1-5H3,(H,14,15)/b13-7+ |
| InChIKey | QSVJWEAYYXSLEO-NTUHNPAUSA-N |
| XLogP | 1.51 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|