About 2-hydroperoxypropan-1-ol;2-methylprop-1-ene
2-hydroperoxypropan-1-ol;2-methylprop-1-ene (PubChem CID 87689130) has the molecular formula C7H16O3
and a molecular weight of 148.20 g/mol. Its IUPAC name is 2-hydroperoxypropan-1-ol;2-methylprop-1-ene.
Molecular Properties
| Compound Name | 2-hydroperoxypropan-1-ol;2-methylprop-1-ene |
| PubChem CID | 87689130 |
| Molecular Formula | C7H16O3 |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.11 |
| IUPAC Name | 2-hydroperoxypropan-1-ol;2-methylprop-1-ene |
| SMILES | C=C(C)C.CC(CO)OO |
| InChI | InChI=1S/C4H8.C3H8O3/c1-4(2)3;1-3(2-4)6-5/h1H2,2-3H3;3-5H,2H2,1H3 |
| InChIKey | HECLZECTPLNOQZ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroperoxypropan-1-ol;2-methylprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroperoxypropan-1-ol;2-methylprop-1-ene?
The IUPAC name of 2-hydroperoxypropan-1-ol;2-methylprop-1-ene (CID 87689130) is 2-hydroperoxypropan-1-ol;2-methylprop-1-ene.
What is the SMILES notation for 2-hydroperoxypropan-1-ol;2-methylprop-1-ene?
The canonical SMILES for 2-hydroperoxypropan-1-ol;2-methylprop-1-ene is C=C(C)C.CC(CO)OO.
What is the InChIKey of 2-hydroperoxypropan-1-ol;2-methylprop-1-ene?
The InChIKey is HECLZECTPLNOQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8.C3H8O3/c1-4(2)3;1-3(2-4)6-5/h1H2,2-3H3;3-5H,2H2,1H3.
What are the key properties of 2-hydroperoxypropan-1-ol;2-methylprop-1-ene?
2-hydroperoxypropan-1-ol;2-methylprop-1-ene has a molecular weight of 148.20 g/mol, XLogP of 1.44, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroperoxypropan-1-ol;2-methylprop-1-ene is sourced from PubChem (CID 87689130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).