About propyl 2-(dimethylamino)-2-(prop-2-enoylamino)acetate;2-(trimethylazaniumyl)acetate
propyl 2-(dimethylamino)-2-(prop-2-enoylamino)acetate;2-(trimethylazaniumyl)acetate (PubChem CID 87689310) has the molecular formula C15H29N3O5
and a molecular weight of 331.41 g/mol. Its IUPAC name is propyl 2-(dimethylamino)-2-(prop-2-enoylamino)acetate;2-(trimethylazaniumyl)acetate.
Molecular Properties
| Compound Name | propyl 2-(dimethylamino)-2-(prop-2-enoylamino)acetate;2-(trimethylazaniumyl)acetate |
| PubChem CID | 87689310 |
| Molecular Formula | C15H29N3O5 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | propyl 2-(dimethylamino)-2-(prop-2-enoylamino)acetate;2-(trimethylazaniumyl)acetate |
| SMILES | C=CC(=O)NC(C(=O)OCCC)N(C)C.C[N+](C)(C)CC(=O)[O-] |
| InChI | InChI=1S/C10H18N2O3.C5H11NO2/c1-5-7-15-10(14)9(12(3)4)11-8(13)6-2;1-6(2,3)4-5(7)8/h6,9H,2,5,7H2,1,3-4H3,(H,11,13);4H2,1-3H3 |
| InChIKey | ZWAFZJMQPUREOP-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze propyl 2-(dimethylamino)-2-(prop-2-enoylamino)acetate;2-(trimethylazaniumyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 2-(dimethylamino)-2-(prop-2-enoylamino)acetate;2-(trimethylazaniumyl)acetate?
The IUPAC name of propyl 2-(dimethylamino)-2-(prop-2-enoylamino)acetate;2-(trimethylazaniumyl)acetate (CID 87689310) is propyl 2-(dimethylamino)-2-(prop-2-enoylamino)acetate;2-(trimethylazaniumyl)acetate.
What is the SMILES notation for propyl 2-(dimethylamino)-2-(prop-2-enoylamino)acetate;2-(trimethylazaniumyl)acetate?
The canonical SMILES for propyl 2-(dimethylamino)-2-(prop-2-enoylamino)acetate;2-(trimethylazaniumyl)acetate is C=CC(=O)NC(C(=O)OCCC)N(C)C.C[N+](C)(C)CC(=O)[O-].
What is the InChIKey of propyl 2-(dimethylamino)-2-(prop-2-enoylamino)acetate;2-(trimethylazaniumyl)acetate?
The InChIKey is ZWAFZJMQPUREOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O3.C5H11NO2/c1-5-7-15-10(14)9(12(3)4)11-8(13)6-2;1-6(2,3)4-5(7)8/h6,9H,2,5,7H2,1,3-4H3,(H,11,13);4H2,1-3H3.
What are the key properties of propyl 2-(dimethylamino)-2-(prop-2-enoylamino)acetate;2-(trimethylazaniumyl)acetate?
propyl 2-(dimethylamino)-2-(prop-2-enoylamino)acetate;2-(trimethylazaniumyl)acetate has a molecular weight of 331.41 g/mol, XLogP of -1.43, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 2-(dimethylamino)-2-(prop-2-enoylamino)acetate;2-(trimethylazaniumyl)acetate is sourced from PubChem (CID 87689310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).