About dihydroxy(dioxo)tungsten;2-methylprop-1-ene;pyrrolidine-2,5-dione
dihydroxy(dioxo)tungsten;2-methylprop-1-ene;pyrrolidine-2,5-dione (PubChem CID 87689592) has the molecular formula C8H15NO6W
and a molecular weight of 405.05 g/mol. Its IUPAC name is dihydroxy(dioxo)tungsten;2-methylprop-1-ene;pyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | dihydroxy(dioxo)tungsten;2-methylprop-1-ene;pyrrolidine-2,5-dione |
| PubChem CID | 87689592 |
| Molecular Formula | C8H15NO6W |
| Molecular Weight | 405.05 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | dihydroxy(dioxo)tungsten;2-methylprop-1-ene;pyrrolidine-2,5-dione |
| SMILES | C=C(C)C.O=C1CCC(=O)N1.O=[W](=O)(O)O |
| InChI | InChI=1S/C4H5NO2.C4H8.2H2O.2O.W/c6-3-1-2-4(7)5-3;1-4(2)3;;;;;/h1-2H2,(H,5,6,7);1H2,2-3H3;2*1H2;;;/q;;;;;;+2/p-2 |
| InChIKey | JIFQMPVKBBHYSY-UHFFFAOYSA-L |
| XLogP | -0.35 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.05 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy(dioxo)tungsten;2-methylprop-1-ene;pyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy(dioxo)tungsten;2-methylprop-1-ene;pyrrolidine-2,5-dione?
The IUPAC name of dihydroxy(dioxo)tungsten;2-methylprop-1-ene;pyrrolidine-2,5-dione (CID 87689592) is dihydroxy(dioxo)tungsten;2-methylprop-1-ene;pyrrolidine-2,5-dione.
What is the SMILES notation for dihydroxy(dioxo)tungsten;2-methylprop-1-ene;pyrrolidine-2,5-dione?
The canonical SMILES for dihydroxy(dioxo)tungsten;2-methylprop-1-ene;pyrrolidine-2,5-dione is C=C(C)C.O=C1CCC(=O)N1.O=[W](=O)(O)O.
What is the InChIKey of dihydroxy(dioxo)tungsten;2-methylprop-1-ene;pyrrolidine-2,5-dione?
The InChIKey is JIFQMPVKBBHYSY-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H5NO2.C4H8.2H2O.2O.W/c6-3-1-2-4(7)5-3;1-4(2)3;;;;;/h1-2H2,(H,5,6,7);1H2,2-3H3;2*1H2;;;/q;;;;;;+2/p-2.
What are the key properties of dihydroxy(dioxo)tungsten;2-methylprop-1-ene;pyrrolidine-2,5-dione?
dihydroxy(dioxo)tungsten;2-methylprop-1-ene;pyrrolidine-2,5-dione has a molecular weight of 405.05 g/mol, XLogP of -0.35, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy(dioxo)tungsten;2-methylprop-1-ene;pyrrolidine-2,5-dione is sourced from PubChem (CID 87689592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).