C46H37NO — CID 87689648
3-[(1Z)-buta-1,3-dienyl]-2,6,6-trimethyl-N,N-bis(4-phenylphenyl)indeno[2,1-g][1]benzofuran-8-amine (PubChem CID 87689648) has the molecular formula C46H37NO and a molecular weight of 619.81 g/mol. Its IUPAC name is 3-[(1Z)-buta-1,3-dienyl]-2,6,6-trimethyl-N,N-bis(4-phenylphenyl)indeno[2,1-g][1]benzofuran-8-amine.
| Compound Name | 3-[(1Z)-buta-1,3-dienyl]-2,6,6-trimethyl-N,N-bis(4-phenylphenyl)indeno[2,1-g][1]benzofuran-8-amine |
|---|---|
| PubChem CID | 87689648 |
| Molecular Formula | C46H37NO |
| Molecular Weight | 619.81 g/mol |
| Exact Mass | 619.29 |
| IUPAC Name | 3-[(1Z)-buta-1,3-dienyl]-2,6,6-trimethyl-N,N-bis(4-phenylphenyl)indeno[2,1-g][1]benzofuran-8-amine |
| SMILES | C=C/C=C\c1c(C)oc2c3c(ccc12)C(C)(C)c1cc(N(c2ccc(-c4ccccc4)cc2)c2ccc(-c4ccccc4)cc2)ccc1-3 |
| InChI | InChI=1S/C46H37NO/c1-5-6-17-39-31(2)48-45-40(39)28-29-42-44(45)41-27-26-38(30-43(41)46(42,3)4)47(36-22-18-34(19-23-36)32-13-9-7-10-14-32)37-24-20-35(21-25-37)33-15-11-8-12-16-33/h5-30H,1H2,2-4H3/b17-6- |
| InChIKey | UXRAFHGKDIXPLZ-FMQZQXMHSA-N |
| XLogP | 13.05 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.81 |
| LogP ≤ 5 | 13.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|