About bis(2-hydroxyethyl-methyl-bis[1-(prop-2-enylamino)ethyl]azanium);sulfate
bis(2-hydroxyethyl-methyl-bis[1-(prop-2-enylamino)ethyl]azanium);sulfate (PubChem CID 87689715) has the molecular formula C26H56N6O6S
and a molecular weight of 580.84 g/mol. Its IUPAC name is bis(2-hydroxyethyl-methyl-bis[1-(prop-2-enylamino)ethyl]azanium);sulfate.
Molecular Properties
| Compound Name | bis(2-hydroxyethyl-methyl-bis[1-(prop-2-enylamino)ethyl]azanium);sulfate |
| PubChem CID | 87689715 |
| Molecular Formula | C26H56N6O6S |
| Molecular Weight | 580.84 g/mol |
| Exact Mass | 580.40 |
| IUPAC Name | bis(2-hydroxyethyl-methyl-bis[1-(prop-2-enylamino)ethyl]azanium);sulfate |
| SMILES | C=CCNC(C)[N+](C)(CCO)C(C)NCC=C.C=CCNC(C)[N+](C)(CCO)C(C)NCC=C.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C13H28N3O.H2O4S/c2*1-6-8-14-12(3)16(5,10-11-17)13(4)15-9-7-2;1-5(2,3)4/h2*6-7,12-15,17H,1-2,8-11H2,3-5H3;(H2,1,2,3,4)/q2*+1;/p-2 |
| InChIKey | YFTGJIYWPNJWMM-UHFFFAOYSA-L |
| XLogP | -0.00 |
| TPSA | 168.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 580.84 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze bis(2-hydroxyethyl-methyl-bis[1-(prop-2-enylamino)ethyl]azanium);sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-hydroxyethyl-methyl-bis[1-(prop-2-enylamino)ethyl]azanium);sulfate?
The IUPAC name of bis(2-hydroxyethyl-methyl-bis[1-(prop-2-enylamino)ethyl]azanium);sulfate (CID 87689715) is bis(2-hydroxyethyl-methyl-bis[1-(prop-2-enylamino)ethyl]azanium);sulfate.
What is the SMILES notation for bis(2-hydroxyethyl-methyl-bis[1-(prop-2-enylamino)ethyl]azanium);sulfate?
The canonical SMILES for bis(2-hydroxyethyl-methyl-bis[1-(prop-2-enylamino)ethyl]azanium);sulfate is C=CCNC(C)[N+](C)(CCO)C(C)NCC=C.C=CCNC(C)[N+](C)(CCO)C(C)NCC=C.O=S(=O)([O-])[O-].
What is the InChIKey of bis(2-hydroxyethyl-methyl-bis[1-(prop-2-enylamino)ethyl]azanium);sulfate?
The InChIKey is YFTGJIYWPNJWMM-UHFFFAOYSA-L. The full InChI is InChI=1S/2C13H28N3O.H2O4S/c2*1-6-8-14-12(3)16(5,10-11-17)13(4)15-9-7-2;1-5(2,3)4/h2*6-7,12-15,17H,1-2,8-11H2,3-5H3;(H2,1,2,3,4)/q2*+1;/p-2.
What are the key properties of bis(2-hydroxyethyl-methyl-bis[1-(prop-2-enylamino)ethyl]azanium);sulfate?
bis(2-hydroxyethyl-methyl-bis[1-(prop-2-enylamino)ethyl]azanium);sulfate has a molecular weight of 580.84 g/mol, XLogP of -0.00, 20 rotatable bonds, 6 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-hydroxyethyl-methyl-bis[1-(prop-2-enylamino)ethyl]azanium);sulfate is sourced from PubChem (CID 87689715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).