C16H14FN3O — CID 87689785
(E)-3-[5-(6-fluoroindol-1-yl)-1,3-dimethylpyrazol-4-yl]prop-2-enal (PubChem CID 87689785) has the molecular formula C16H14FN3O and a molecular weight of 283.31 g/mol. Its IUPAC name is (E)-3-[5-(6-fluoroindol-1-yl)-1,3-dimethylpyrazol-4-yl]prop-2-enal.
| Compound Name | (E)-3-[5-(6-fluoroindol-1-yl)-1,3-dimethylpyrazol-4-yl]prop-2-enal |
|---|---|
| PubChem CID | 87689785 |
| Molecular Formula | C16H14FN3O |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | (E)-3-[5-(6-fluoroindol-1-yl)-1,3-dimethylpyrazol-4-yl]prop-2-enal |
| SMILES | Cc1nn(C)c(-n2ccc3ccc(F)cc32)c1/C=C/C=O |
| InChI | InChI=1S/C16H14FN3O/c1-11-14(4-3-9-21)16(19(2)18-11)20-8-7-12-5-6-13(17)10-15(12)20/h3-10H,1-2H3/b4-3+ |
| InChIKey | AHVUBWSCMXOQOE-ONEGZZNKSA-N |
| XLogP | 3.02 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|