C18H9BrCl4N2O5 — CID 87690151
2-(3-bromo-5-chlorophenoxy)-1-chloro-3-nitrobenzene;1,2-dichloro-3-nitrobenzene (PubChem CID 87690151) has the molecular formula C18H9BrCl4N2O5 and a molecular weight of 555.00 g/mol. Its IUPAC name is 2-(3-bromo-5-chlorophenoxy)-1-chloro-3-nitrobenzene;1,2-dichloro-3-nitrobenzene.
| Compound Name | 2-(3-bromo-5-chlorophenoxy)-1-chloro-3-nitrobenzene;1,2-dichloro-3-nitrobenzene |
|---|---|
| PubChem CID | 87690151 |
| Molecular Formula | C18H9BrCl4N2O5 |
| Molecular Weight | 555.00 g/mol |
| Exact Mass | 551.84 |
| IUPAC Name | 2-(3-bromo-5-chlorophenoxy)-1-chloro-3-nitrobenzene;1,2-dichloro-3-nitrobenzene |
| SMILES | O=[N+]([O-])c1cccc(Cl)c1Cl.O=[N+]([O-])c1cccc(Cl)c1Oc1cc(Cl)cc(Br)c1 |
| InChI | InChI=1S/C12H6BrCl2NO3.C6H3Cl2NO2/c13-7-4-8(14)6-9(5-7)19-12-10(15)2-1-3-11(12)16(17)18;7-4-2-1-3-5(6(4)8)9(10)11/h1-6H;1-3H |
| InChIKey | VRQAIYVZNGSBFU-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.00 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|