About 1-azido-1-pentylthiourea
1-azido-1-pentylthiourea (PubChem CID 87690632) has the molecular formula C6H13N5S
and a molecular weight of 187.27 g/mol. Its IUPAC name is 1-azido-1-pentylthiourea.
Molecular Properties
| Compound Name | 1-azido-1-pentylthiourea |
| PubChem CID | 87690632 |
| Molecular Formula | C6H13N5S |
| Molecular Weight | 187.27 g/mol |
| Exact Mass | 187.09 |
| IUPAC Name | 1-azido-1-pentylthiourea |
| SMILES | CCCCCN(N=[N+]=[N-])C(N)=S |
| InChI | InChI=1S/C6H13N5S/c1-2-3-4-5-11(6(7)12)10-9-8/h2-5H2,1H3,(H2,7,12) |
| InChIKey | FLECGDGUSMJFDE-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 78.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.27 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-azido-1-pentylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azido-1-pentylthiourea?
The IUPAC name of 1-azido-1-pentylthiourea (CID 87690632) is 1-azido-1-pentylthiourea.
What is the SMILES notation for 1-azido-1-pentylthiourea?
The canonical SMILES for 1-azido-1-pentylthiourea is CCCCCN(N=[N+]=[N-])C(N)=S.
What is the InChIKey of 1-azido-1-pentylthiourea?
The InChIKey is FLECGDGUSMJFDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N5S/c1-2-3-4-5-11(6(7)12)10-9-8/h2-5H2,1H3,(H2,7,12).
What are the key properties of 1-azido-1-pentylthiourea?
1-azido-1-pentylthiourea has a molecular weight of 187.27 g/mol, XLogP of 1.95, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azido-1-pentylthiourea is sourced from PubChem (CID 87690632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).