About 1-chloro-9-(3-methoxyphenyl)-6,7-dihydropurin-8-one
1-chloro-9-(3-methoxyphenyl)-6,7-dihydropurin-8-one (PubChem CID 87690687) has the molecular formula C12H11ClN4O2
and a molecular weight of 278.70 g/mol. Its IUPAC name is 1-chloro-9-(3-methoxyphenyl)-6,7-dihydropurin-8-one.
Molecular Properties
| Compound Name | 1-chloro-9-(3-methoxyphenyl)-6,7-dihydropurin-8-one |
| PubChem CID | 87690687 |
| Molecular Formula | C12H11ClN4O2 |
| Molecular Weight | 278.70 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 1-chloro-9-(3-methoxyphenyl)-6,7-dihydropurin-8-one |
| SMILES | COc1cccc(-n2c3c([nH]c2=O)CN(Cl)C=N3)c1 |
| InChI | InChI=1S/C12H11ClN4O2/c1-19-9-4-2-3-8(5-9)17-11-10(15-12(17)18)6-16(13)7-14-11/h2-5,7H,6H2,1H3,(H,15,18) |
| InChIKey | COFHMPAKIDQFNR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 62.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.70 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-9-(3-methoxyphenyl)-6,7-dihydropurin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-9-(3-methoxyphenyl)-6,7-dihydropurin-8-one?
The IUPAC name of 1-chloro-9-(3-methoxyphenyl)-6,7-dihydropurin-8-one (CID 87690687) is 1-chloro-9-(3-methoxyphenyl)-6,7-dihydropurin-8-one.
What is the SMILES notation for 1-chloro-9-(3-methoxyphenyl)-6,7-dihydropurin-8-one?
The canonical SMILES for 1-chloro-9-(3-methoxyphenyl)-6,7-dihydropurin-8-one is COc1cccc(-n2c3c([nH]c2=O)CN(Cl)C=N3)c1.
What is the InChIKey of 1-chloro-9-(3-methoxyphenyl)-6,7-dihydropurin-8-one?
The InChIKey is COFHMPAKIDQFNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11ClN4O2/c1-19-9-4-2-3-8(5-9)17-11-10(15-12(17)18)6-16(13)7-14-11/h2-5,7H,6H2,1H3,(H,15,18).
What are the key properties of 1-chloro-9-(3-methoxyphenyl)-6,7-dihydropurin-8-one?
1-chloro-9-(3-methoxyphenyl)-6,7-dihydropurin-8-one has a molecular weight of 278.70 g/mol, XLogP of 1.80, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-9-(3-methoxyphenyl)-6,7-dihydropurin-8-one is sourced from PubChem (CID 87690687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).