About 1-N-[1-(dimethylamino)prop-2-enyl]-1-N',1-N'-dimethylprop-2-ene-1,1-diamine
1-N-[1-(dimethylamino)prop-2-enyl]-1-N',1-N'-dimethylprop-2-ene-1,1-diamine (PubChem CID 87691306) has the molecular formula C10H21N3
and a molecular weight of 183.30 g/mol. Its IUPAC name is 1-N-[1-(dimethylamino)prop-2-enyl]-1-N',1-N'-dimethylprop-2-ene-1,1-diamine.
Molecular Properties
| Compound Name | 1-N-[1-(dimethylamino)prop-2-enyl]-1-N',1-N'-dimethylprop-2-ene-1,1-diamine |
| PubChem CID | 87691306 |
| Molecular Formula | C10H21N3 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.17 |
| IUPAC Name | 1-N-[1-(dimethylamino)prop-2-enyl]-1-N',1-N'-dimethylprop-2-ene-1,1-diamine |
| SMILES | C=CC(NC(C=C)N(C)C)N(C)C |
| InChI | InChI=1S/C10H21N3/c1-7-9(12(3)4)11-10(8-2)13(5)6/h7-11H,1-2H2,3-6H3 |
| InChIKey | BXKRONNKGUPRIZ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-N-[1-(dimethylamino)prop-2-enyl]-1-N',1-N'-dimethylprop-2-ene-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-[1-(dimethylamino)prop-2-enyl]-1-N',1-N'-dimethylprop-2-ene-1,1-diamine?
The IUPAC name of 1-N-[1-(dimethylamino)prop-2-enyl]-1-N',1-N'-dimethylprop-2-ene-1,1-diamine (CID 87691306) is 1-N-[1-(dimethylamino)prop-2-enyl]-1-N',1-N'-dimethylprop-2-ene-1,1-diamine.
What is the SMILES notation for 1-N-[1-(dimethylamino)prop-2-enyl]-1-N',1-N'-dimethylprop-2-ene-1,1-diamine?
The canonical SMILES for 1-N-[1-(dimethylamino)prop-2-enyl]-1-N',1-N'-dimethylprop-2-ene-1,1-diamine is C=CC(NC(C=C)N(C)C)N(C)C.
What is the InChIKey of 1-N-[1-(dimethylamino)prop-2-enyl]-1-N',1-N'-dimethylprop-2-ene-1,1-diamine?
The InChIKey is BXKRONNKGUPRIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N3/c1-7-9(12(3)4)11-10(8-2)13(5)6/h7-11H,1-2H2,3-6H3.
What are the key properties of 1-N-[1-(dimethylamino)prop-2-enyl]-1-N',1-N'-dimethylprop-2-ene-1,1-diamine?
1-N-[1-(dimethylamino)prop-2-enyl]-1-N',1-N'-dimethylprop-2-ene-1,1-diamine has a molecular weight of 183.30 g/mol, XLogP of 0.72, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-[1-(dimethylamino)prop-2-enyl]-1-N',1-N'-dimethylprop-2-ene-1,1-diamine is sourced from PubChem (CID 87691306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).