C13H25ClN2O4 — CID 87691473
1-chloro-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-2,2,5,5-tetramethylimidazolidin-4-one (PubChem CID 87691473) has the molecular formula C13H25ClN2O4 and a molecular weight of 308.81 g/mol. Its IUPAC name is 1-chloro-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-2,2,5,5-tetramethylimidazolidin-4-one.
| Compound Name | 1-chloro-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-2,2,5,5-tetramethylimidazolidin-4-one |
|---|---|
| PubChem CID | 87691473 |
| Molecular Formula | C13H25ClN2O4 |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 1-chloro-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-2,2,5,5-tetramethylimidazolidin-4-one |
| SMILES | CC1(C)C(=O)N(CCOCCOCCO)C(C)(C)N1Cl |
| InChI | InChI=1S/C13H25ClN2O4/c1-12(2)11(18)15(13(3,4)16(12)14)5-7-19-9-10-20-8-6-17/h17H,5-10H2,1-4H3 |
| InChIKey | MORYJGHATNAZHU-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|