C15H29ClN2O4 — CID 87691474
1-chloro-3-[2-[2-(2-ethoxyethoxy)ethoxy]ethyl]-2,2,5,5-tetramethylimidazolidin-4-one (PubChem CID 87691474) has the molecular formula C15H29ClN2O4 and a molecular weight of 336.86 g/mol. Its IUPAC name is 1-chloro-3-[2-[2-(2-ethoxyethoxy)ethoxy]ethyl]-2,2,5,5-tetramethylimidazolidin-4-one.
| Compound Name | 1-chloro-3-[2-[2-(2-ethoxyethoxy)ethoxy]ethyl]-2,2,5,5-tetramethylimidazolidin-4-one |
|---|---|
| PubChem CID | 87691474 |
| Molecular Formula | C15H29ClN2O4 |
| Molecular Weight | 336.86 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 1-chloro-3-[2-[2-(2-ethoxyethoxy)ethoxy]ethyl]-2,2,5,5-tetramethylimidazolidin-4-one |
| SMILES | CCOCCOCCOCCN1C(=O)C(C)(C)N(Cl)C1(C)C |
| InChI | InChI=1S/C15H29ClN2O4/c1-6-20-9-10-22-12-11-21-8-7-17-13(19)14(2,3)18(16)15(17,4)5/h6-12H2,1-5H3 |
| InChIKey | BZMDDTHPROFZBK-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.86 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|