About 2-dimethylsulfonio-3,3-dihydroxy-2-(oxolan-2-yl)butanoate
2-dimethylsulfonio-3,3-dihydroxy-2-(oxolan-2-yl)butanoate (PubChem CID 87691598) has the molecular formula C10H18O5S
and a molecular weight of 250.32 g/mol. Its IUPAC name is 2-dimethylsulfonio-3,3-dihydroxy-2-(oxolan-2-yl)butanoate.
Molecular Properties
| Compound Name | 2-dimethylsulfonio-3,3-dihydroxy-2-(oxolan-2-yl)butanoate |
| PubChem CID | 87691598 |
| Molecular Formula | C10H18O5S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 2-dimethylsulfonio-3,3-dihydroxy-2-(oxolan-2-yl)butanoate |
| SMILES | C[S+](C)C(C(=O)[O-])(C1CCCO1)C(C)(O)O |
| InChI | InChI=1S/C10H18O5S/c1-9(13,14)10(8(11)12,16(2)3)7-5-4-6-15-7/h7,13-14H,4-6H2,1-3H3 |
| InChIKey | NPQKXOHEEZVFBU-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 89.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-dimethylsulfonio-3,3-dihydroxy-2-(oxolan-2-yl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-dimethylsulfonio-3,3-dihydroxy-2-(oxolan-2-yl)butanoate?
The IUPAC name of 2-dimethylsulfonio-3,3-dihydroxy-2-(oxolan-2-yl)butanoate (CID 87691598) is 2-dimethylsulfonio-3,3-dihydroxy-2-(oxolan-2-yl)butanoate.
What is the SMILES notation for 2-dimethylsulfonio-3,3-dihydroxy-2-(oxolan-2-yl)butanoate?
The canonical SMILES for 2-dimethylsulfonio-3,3-dihydroxy-2-(oxolan-2-yl)butanoate is C[S+](C)C(C(=O)[O-])(C1CCCO1)C(C)(O)O.
What is the InChIKey of 2-dimethylsulfonio-3,3-dihydroxy-2-(oxolan-2-yl)butanoate?
The InChIKey is NPQKXOHEEZVFBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O5S/c1-9(13,14)10(8(11)12,16(2)3)7-5-4-6-15-7/h7,13-14H,4-6H2,1-3H3.
What are the key properties of 2-dimethylsulfonio-3,3-dihydroxy-2-(oxolan-2-yl)butanoate?
2-dimethylsulfonio-3,3-dihydroxy-2-(oxolan-2-yl)butanoate has a molecular weight of 250.32 g/mol, XLogP of -1.77, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-dimethylsulfonio-3,3-dihydroxy-2-(oxolan-2-yl)butanoate is sourced from PubChem (CID 87691598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).