About 2-dimethylsulfonio-3,4-dihydroxy-2-(oxolan-2-yl)butanoate
2-dimethylsulfonio-3,4-dihydroxy-2-(oxolan-2-yl)butanoate (PubChem CID 87691602) has the molecular formula C10H18O5S
and a molecular weight of 250.32 g/mol. Its IUPAC name is 2-dimethylsulfonio-3,4-dihydroxy-2-(oxolan-2-yl)butanoate.
Molecular Properties
| Compound Name | 2-dimethylsulfonio-3,4-dihydroxy-2-(oxolan-2-yl)butanoate |
| PubChem CID | 87691602 |
| Molecular Formula | C10H18O5S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 2-dimethylsulfonio-3,4-dihydroxy-2-(oxolan-2-yl)butanoate |
| SMILES | C[S+](C)C(C(=O)[O-])(C(O)CO)C1CCCO1 |
| InChI | InChI=1S/C10H18O5S/c1-16(2)10(9(13)14,7(12)6-11)8-4-3-5-15-8/h7-8,11-12H,3-6H2,1-2H3 |
| InChIKey | OEPSKFMROUNNIL-UHFFFAOYSA-N |
| XLogP | -2.11 |
| TPSA | 89.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 2-dimethylsulfonio-3,4-dihydroxy-2-(oxolan-2-yl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-dimethylsulfonio-3,4-dihydroxy-2-(oxolan-2-yl)butanoate?
The IUPAC name of 2-dimethylsulfonio-3,4-dihydroxy-2-(oxolan-2-yl)butanoate (CID 87691602) is 2-dimethylsulfonio-3,4-dihydroxy-2-(oxolan-2-yl)butanoate.
What is the SMILES notation for 2-dimethylsulfonio-3,4-dihydroxy-2-(oxolan-2-yl)butanoate?
The canonical SMILES for 2-dimethylsulfonio-3,4-dihydroxy-2-(oxolan-2-yl)butanoate is C[S+](C)C(C(=O)[O-])(C(O)CO)C1CCCO1.
What is the InChIKey of 2-dimethylsulfonio-3,4-dihydroxy-2-(oxolan-2-yl)butanoate?
The InChIKey is OEPSKFMROUNNIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O5S/c1-16(2)10(9(13)14,7(12)6-11)8-4-3-5-15-8/h7-8,11-12H,3-6H2,1-2H3.
What are the key properties of 2-dimethylsulfonio-3,4-dihydroxy-2-(oxolan-2-yl)butanoate?
2-dimethylsulfonio-3,4-dihydroxy-2-(oxolan-2-yl)butanoate has a molecular weight of 250.32 g/mol, XLogP of -2.11, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-dimethylsulfonio-3,4-dihydroxy-2-(oxolan-2-yl)butanoate is sourced from PubChem (CID 87691602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).