C14H26AsNO4S — CID 87693385
(3aR,5R,6S,7R,7aR)-2-dimethylarsanyl-5-(6-hydroxyhexyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol (PubChem CID 87693385) has the molecular formula C14H26AsNO4S and a molecular weight of 379.35 g/mol. Its IUPAC name is (3aR,5R,6S,7R,7aR)-2-dimethylarsanyl-5-(6-hydroxyhexyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol.
| Compound Name | (3aR,5R,6S,7R,7aR)-2-dimethylarsanyl-5-(6-hydroxyhexyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol |
|---|---|
| PubChem CID | 87693385 |
| Molecular Formula | C14H26AsNO4S |
| Molecular Weight | 379.35 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | (3aR,5R,6S,7R,7aR)-2-dimethylarsanyl-5-(6-hydroxyhexyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol |
| SMILES | C[As](C)C1=N[C@@H]2[C@@H](O)[C@H](O)[C@@H](CCCCCCO)O[C@@H]2S1 |
| InChI | InChI=1S/C14H26AsNO4S/c1-15(2)14-16-10-12(19)11(18)9(20-13(10)21-14)7-5-3-4-6-8-17/h9-13,17-19H,3-8H2,1-2H3/t9-,10-,11-,12-,13-/m1/s1 |
| InChIKey | WAVKYLPVIRKQJH-SYLRKERUSA-N |
| XLogP | 1.18 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.35 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|