C16H8O2S4 — CID 87693403
15-methoxy-5,9,14,18-tetrathiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaene-6-carbaldehyde (PubChem CID 87693403) has the molecular formula C16H8O2S4 and a molecular weight of 360.51 g/mol. Its IUPAC name is 15-methoxy-5,9,14,18-tetrathiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaene-6-carbaldehyde.
| Compound Name | 15-methoxy-5,9,14,18-tetrathiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaene-6-carbaldehyde |
|---|---|
| PubChem CID | 87693403 |
| Molecular Formula | C16H8O2S4 |
| Molecular Weight | 360.51 g/mol |
| Exact Mass | 359.94 |
| IUPAC Name | 15-methoxy-5,9,14,18-tetrathiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaene-6-carbaldehyde |
| SMILES | COc1cc2sc3cc4c(cc3c2s1)sc1cc(C=O)sc14 |
| InChI | InChI=1S/C16H8O2S4/c1-18-14-5-13-16(22-14)9-4-10-8(3-11(9)21-13)15-12(20-10)2-7(6-17)19-15/h2-6H,1H3 |
| InChIKey | RTVSXIKUPWJBFL-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.51 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|