About 4-(3-hydroxy-2,3-dimethylbutoxy)-2,4-dimethylpent-1-en-3-one
4-(3-hydroxy-2,3-dimethylbutoxy)-2,4-dimethylpent-1-en-3-one (PubChem CID 87693664) has the molecular formula C13H24O3
and a molecular weight of 228.33 g/mol. Its IUPAC name is 4-(3-hydroxy-2,3-dimethylbutoxy)-2,4-dimethylpent-1-en-3-one.
Molecular Properties
| Compound Name | 4-(3-hydroxy-2,3-dimethylbutoxy)-2,4-dimethylpent-1-en-3-one |
| PubChem CID | 87693664 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 4-(3-hydroxy-2,3-dimethylbutoxy)-2,4-dimethylpent-1-en-3-one |
| SMILES | C=C(C)C(=O)C(C)(C)OCC(C)C(C)(C)O |
| InChI | InChI=1S/C13H24O3/c1-9(2)11(14)13(6,7)16-8-10(3)12(4,5)15/h10,15H,1,8H2,2-7H3 |
| InChIKey | GETNUDZPPNOKSH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-hydroxy-2,3-dimethylbutoxy)-2,4-dimethylpent-1-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-hydroxy-2,3-dimethylbutoxy)-2,4-dimethylpent-1-en-3-one?
The IUPAC name of 4-(3-hydroxy-2,3-dimethylbutoxy)-2,4-dimethylpent-1-en-3-one (CID 87693664) is 4-(3-hydroxy-2,3-dimethylbutoxy)-2,4-dimethylpent-1-en-3-one.
What is the SMILES notation for 4-(3-hydroxy-2,3-dimethylbutoxy)-2,4-dimethylpent-1-en-3-one?
The canonical SMILES for 4-(3-hydroxy-2,3-dimethylbutoxy)-2,4-dimethylpent-1-en-3-one is C=C(C)C(=O)C(C)(C)OCC(C)C(C)(C)O.
What is the InChIKey of 4-(3-hydroxy-2,3-dimethylbutoxy)-2,4-dimethylpent-1-en-3-one?
The InChIKey is GETNUDZPPNOKSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O3/c1-9(2)11(14)13(6,7)16-8-10(3)12(4,5)15/h10,15H,1,8H2,2-7H3.
What are the key properties of 4-(3-hydroxy-2,3-dimethylbutoxy)-2,4-dimethylpent-1-en-3-one?
4-(3-hydroxy-2,3-dimethylbutoxy)-2,4-dimethylpent-1-en-3-one has a molecular weight of 228.33 g/mol, XLogP of 2.33, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-hydroxy-2,3-dimethylbutoxy)-2,4-dimethylpent-1-en-3-one is sourced from PubChem (CID 87693664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).