About [(1Z,3Z)-2-methylpenta-1,3-dienyl]diazene
[(1Z,3Z)-2-methylpenta-1,3-dienyl]diazene (PubChem CID 87693669) has the molecular formula C6H10N2
and a molecular weight of 110.16 g/mol. Its IUPAC name is [(1Z,3Z)-2-methylpenta-1,3-dienyl]diazene.
Molecular Properties
| Compound Name | [(1Z,3Z)-2-methylpenta-1,3-dienyl]diazene |
| PubChem CID | 87693669 |
| Molecular Formula | C6H10N2 |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.08 |
| IUPAC Name | [(1Z,3Z)-2-methylpenta-1,3-dienyl]diazene |
| SMILES | [H]/N=N/C=C(C)\C=C/C |
| InChI | InChI=1S/C6H10N2/c1-3-4-6(2)5-8-7/h3-5,7H,1-2H3/b4-3-,6-5-,8-7+ |
| InChIKey | AEUCJHSCUYMJTM-YUHUOFHPSA-N |
| XLogP | 2.50 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(1Z,3Z)-2-methylpenta-1,3-dienyl]diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1Z,3Z)-2-methylpenta-1,3-dienyl]diazene?
The IUPAC name of [(1Z,3Z)-2-methylpenta-1,3-dienyl]diazene (CID 87693669) is [(1Z,3Z)-2-methylpenta-1,3-dienyl]diazene.
What is the SMILES notation for [(1Z,3Z)-2-methylpenta-1,3-dienyl]diazene?
The canonical SMILES for [(1Z,3Z)-2-methylpenta-1,3-dienyl]diazene is [H]/N=N/C=C(C)\C=C/C.
What is the InChIKey of [(1Z,3Z)-2-methylpenta-1,3-dienyl]diazene?
The InChIKey is AEUCJHSCUYMJTM-YUHUOFHPSA-N. The full InChI is InChI=1S/C6H10N2/c1-3-4-6(2)5-8-7/h3-5,7H,1-2H3/b4-3-,6-5-,8-7+.
What are the key properties of [(1Z,3Z)-2-methylpenta-1,3-dienyl]diazene?
[(1Z,3Z)-2-methylpenta-1,3-dienyl]diazene has a molecular weight of 110.16 g/mol, XLogP of 2.50, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1Z,3Z)-2-methylpenta-1,3-dienyl]diazene is sourced from PubChem (CID 87693669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).