C35H39F3O5S — CID 87693748
[3-[2-[(13S,17R)-3,17-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]ethyl]-4-(trifluoromethyl)phenyl]methyl 4-methylbenzenesulfonate (PubChem CID 87693748) has the molecular formula C35H39F3O5S and a molecular weight of 628.75 g/mol. Its IUPAC name is [3-[2-[(13S,17R)-3,17-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]ethyl]-4-(trifluoromethyl)phenyl]methyl 4-methylbenzenesulfonate.
| Compound Name | [3-[2-[(13S,17R)-3,17-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]ethyl]-4-(trifluoromethyl)phenyl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87693748 |
| Molecular Formula | C35H39F3O5S |
| Molecular Weight | 628.75 g/mol |
| Exact Mass | 628.25 |
| IUPAC Name | [3-[2-[(13S,17R)-3,17-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]ethyl]-4-(trifluoromethyl)phenyl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCc2ccc(C(F)(F)F)c(CC[C@]3(O)CCC4C5CCc6cc(O)ccc6C5CC[C@@]43C)c2)cc1 |
| InChI | InChI=1S/C35H39F3O5S/c1-22-3-8-27(9-4-22)44(41,42)43-21-23-5-12-31(35(36,37)38)25(19-23)13-17-34(40)18-15-32-30-10-6-24-20-26(39)7-11-28(24)29(30)14-16-33(32,34)2/h3-5,7-9,11-12,19-20,29-30,32,39-40H,6,10,13-18,21H2,1-2H3/t29?,30?,32?,33-,34-/m0/s1 |
| InChIKey | OHVTWTKFMFXDMO-MWRDLPDBSA-N |
| XLogP | 7.84 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.75 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|