About pyridin-2-yl ethaneperoxoate
pyridin-2-yl ethaneperoxoate (PubChem CID 87694158) has the molecular formula C7H7NO3
and a molecular weight of 153.14 g/mol. Its IUPAC name is pyridin-2-yl ethaneperoxoate.
Molecular Properties
| Compound Name | pyridin-2-yl ethaneperoxoate |
| PubChem CID | 87694158 |
| Molecular Formula | C7H7NO3 |
| Molecular Weight | 153.14 g/mol |
| Exact Mass | 153.04 |
| IUPAC Name | pyridin-2-yl ethaneperoxoate |
| SMILES | CC(=O)OOc1ccccn1 |
| InChI | InChI=1S/C7H7NO3/c1-6(9)10-11-7-4-2-3-5-8-7/h2-5H,1H3 |
| InChIKey | SAJNXQHFTAPPHV-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.14 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze pyridin-2-yl ethaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-2-yl ethaneperoxoate?
The IUPAC name of pyridin-2-yl ethaneperoxoate (CID 87694158) is pyridin-2-yl ethaneperoxoate.
What is the SMILES notation for pyridin-2-yl ethaneperoxoate?
The canonical SMILES for pyridin-2-yl ethaneperoxoate is CC(=O)OOc1ccccn1.
What is the InChIKey of pyridin-2-yl ethaneperoxoate?
The InChIKey is SAJNXQHFTAPPHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO3/c1-6(9)10-11-7-4-2-3-5-8-7/h2-5H,1H3.
What are the key properties of pyridin-2-yl ethaneperoxoate?
pyridin-2-yl ethaneperoxoate has a molecular weight of 153.14 g/mol, XLogP of 0.94, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-2-yl ethaneperoxoate is sourced from PubChem (CID 87694158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).