C5H9F5N+ — CID 87694541
trimethyl(1,1,2,2,2-pentafluoroethyl)azanium (PubChem CID 87694541) has the molecular formula C5H9F5N+ and a molecular weight of 178.12 g/mol. Its IUPAC name is trimethyl(1,1,2,2,2-pentafluoroethyl)azanium.
| Compound Name | trimethyl(1,1,2,2,2-pentafluoroethyl)azanium |
|---|---|
| PubChem CID | 87694541 |
| Molecular Formula | C5H9F5N+ |
| Molecular Weight | 178.12 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | trimethyl(1,1,2,2,2-pentafluoroethyl)azanium |
| SMILES | C[N+](C)(C)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5H9F5N/c1-11(2,3)5(9,10)4(6,7)8/h1-3H3/q+1 |
| InChIKey | VGBDRMMMSGQOKC-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.12 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|