C46H34BrNO4 — CID 87694785
5-bromo-16-[2,6-di(propan-2-yl)phenyl]-12,20-diphenoxy-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2(23),3,5,7,9,11,13,18,21-decaene-15,17-dione (PubChem CID 87694785) has the molecular formula C46H34BrNO4 and a molecular weight of 744.69 g/mol. Its IUPAC name is 5-bromo-16-[2,6-di(propan-2-yl)phenyl]-12,20-diphenoxy-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2(23),3,5,7,9,11,13,18,21-decaene-15,17-dione.
| Compound Name | 5-bromo-16-[2,6-di(propan-2-yl)phenyl]-12,20-diphenoxy-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2(23),3,5,7,9,11,13,18,21-decaene-15,17-dione |
|---|---|
| PubChem CID | 87694785 |
| Molecular Formula | C46H34BrNO4 |
| Molecular Weight | 744.69 g/mol |
| Exact Mass | 743.17 |
| IUPAC Name | 5-bromo-16-[2,6-di(propan-2-yl)phenyl]-12,20-diphenoxy-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2(23),3,5,7,9,11,13,18,21-decaene-15,17-dione |
| SMILES | CC(C)c1cccc(C(C)C)c1N1C(=O)c2cc(Oc3ccccc3)c3c4cccc5c(Br)ccc(c6c(Oc7ccccc7)cc(c2c36)C1=O)c54 |
| InChI | InChI=1S/C46H34BrNO4/c1-25(2)29-17-11-18-30(26(3)4)44(29)48-45(49)34-23-37(51-27-13-7-5-8-14-27)41-32-20-12-19-31-36(47)22-21-33(39(31)32)42-38(52-28-15-9-6-10-16-28)24-35(46(48)50)40(34)43(41)42/h5-26H,1-4H3 |
| InChIKey | GWRODCYAHLDDIN-UHFFFAOYSA-N |
| XLogP | 13.13 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.69 |
| LogP ≤ 5 | 13.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|