C24H24N4O4 — CID 87694803
1,2-bis(isocyanatomethyl)benzene;1,2-bis(isocyanatomethyl)-3,4,5,6-tetramethylbenzene (PubChem CID 87694803) has the molecular formula C24H24N4O4 and a molecular weight of 432.48 g/mol. Its IUPAC name is 1,2-bis(isocyanatomethyl)benzene;1,2-bis(isocyanatomethyl)-3,4,5,6-tetramethylbenzene.
| Compound Name | 1,2-bis(isocyanatomethyl)benzene;1,2-bis(isocyanatomethyl)-3,4,5,6-tetramethylbenzene |
|---|---|
| PubChem CID | 87694803 |
| Molecular Formula | C24H24N4O4 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 1,2-bis(isocyanatomethyl)benzene;1,2-bis(isocyanatomethyl)-3,4,5,6-tetramethylbenzene |
| SMILES | Cc1c(C)c(C)c(CN=C=O)c(CN=C=O)c1C.O=C=NCc1ccccc1CN=C=O |
| InChI | InChI=1S/C14H16N2O2.C10H8N2O2/c1-9-10(2)12(4)14(6-16-8-18)13(11(9)3)5-15-7-17;13-7-11-5-9-3-1-2-4-10(9)6-12-8-14/h5-6H2,1-4H3;1-4H,5-6H2 |
| InChIKey | CUDVQGCYFTZPFW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 117.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|