About 2-tert-butylperoxy-2-ethylhexanoic acid;(2-methylpropan-2-yl)oxy ethaneperoxoate
2-tert-butylperoxy-2-ethylhexanoic acid;(2-methylpropan-2-yl)oxy ethaneperoxoate (PubChem CID 87694854) has the molecular formula C18H36O8
and a molecular weight of 380.48 g/mol. Its IUPAC name is 2-tert-butylperoxy-2-ethylhexanoic acid;(2-methylpropan-2-yl)oxy ethaneperoxoate.
Molecular Properties
| Compound Name | 2-tert-butylperoxy-2-ethylhexanoic acid;(2-methylpropan-2-yl)oxy ethaneperoxoate |
| PubChem CID | 87694854 |
| Molecular Formula | C18H36O8 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | 2-tert-butylperoxy-2-ethylhexanoic acid;(2-methylpropan-2-yl)oxy ethaneperoxoate |
| SMILES | CC(=O)OOOC(C)(C)C.CCCCC(CC)(OOC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C12H24O4.C6H12O4/c1-6-8-9-12(7-2,10(13)14)16-15-11(3,4)5;1-5(7)8-10-9-6(2,3)4/h6-9H2,1-5H3,(H,13,14);1-4H3 |
| InChIKey | SZTFEXIMUWMGMA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butylperoxy-2-ethylhexanoic acid;(2-methylpropan-2-yl)oxy ethaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butylperoxy-2-ethylhexanoic acid;(2-methylpropan-2-yl)oxy ethaneperoxoate?
The IUPAC name of 2-tert-butylperoxy-2-ethylhexanoic acid;(2-methylpropan-2-yl)oxy ethaneperoxoate (CID 87694854) is 2-tert-butylperoxy-2-ethylhexanoic acid;(2-methylpropan-2-yl)oxy ethaneperoxoate.
What is the SMILES notation for 2-tert-butylperoxy-2-ethylhexanoic acid;(2-methylpropan-2-yl)oxy ethaneperoxoate?
The canonical SMILES for 2-tert-butylperoxy-2-ethylhexanoic acid;(2-methylpropan-2-yl)oxy ethaneperoxoate is CC(=O)OOOC(C)(C)C.CCCCC(CC)(OOC(C)(C)C)C(=O)O.
What is the InChIKey of 2-tert-butylperoxy-2-ethylhexanoic acid;(2-methylpropan-2-yl)oxy ethaneperoxoate?
The InChIKey is SZTFEXIMUWMGMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O4.C6H12O4/c1-6-8-9-12(7-2,10(13)14)16-15-11(3,4)5;1-5(7)8-10-9-6(2,3)4/h6-9H2,1-5H3,(H,13,14);1-4H3.
What are the key properties of 2-tert-butylperoxy-2-ethylhexanoic acid;(2-methylpropan-2-yl)oxy ethaneperoxoate?
2-tert-butylperoxy-2-ethylhexanoic acid;(2-methylpropan-2-yl)oxy ethaneperoxoate has a molecular weight of 380.48 g/mol, XLogP of 4.37, 9 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butylperoxy-2-ethylhexanoic acid;(2-methylpropan-2-yl)oxy ethaneperoxoate is sourced from PubChem (CID 87694854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).