C18H29N7O3 — CID 87695036
N-[(2R)-3-[amino-[4-(cyclopropylamino)-6-ethyl-1,3,5-triazin-2-yl]amino]-2-(cyclopentylmethyl)-3-oxopropyl]-N-hydroxyformamide (PubChem CID 87695036) has the molecular formula C18H29N7O3 and a molecular weight of 391.48 g/mol. Its IUPAC name is N-[(2R)-3-[amino-[4-(cyclopropylamino)-6-ethyl-1,3,5-triazin-2-yl]amino]-2-(cyclopentylmethyl)-3-oxopropyl]-N-hydroxyformamide.
| Compound Name | N-[(2R)-3-[amino-[4-(cyclopropylamino)-6-ethyl-1,3,5-triazin-2-yl]amino]-2-(cyclopentylmethyl)-3-oxopropyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 87695036 |
| Molecular Formula | C18H29N7O3 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | N-[(2R)-3-[amino-[4-(cyclopropylamino)-6-ethyl-1,3,5-triazin-2-yl]amino]-2-(cyclopentylmethyl)-3-oxopropyl]-N-hydroxyformamide |
| SMILES | CCc1nc(NC2CC2)nc(N(N)C(=O)[C@H](CC2CCCC2)CN(O)C=O)n1 |
| InChI | InChI=1S/C18H29N7O3/c1-2-15-21-17(20-14-7-8-14)23-18(22-15)25(19)16(27)13(10-24(28)11-26)9-12-5-3-4-6-12/h11-14,28H,2-10,19H2,1H3,(H,20,21,22,23)/t13-/m1/s1 |
| InChIKey | SDLMJLCVVNHGKW-CYBMUJFWSA-N |
| XLogP | 1.26 |
| TPSA | 137.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|