C30H50O2 — CID 87695084
2,2-dimethyl-3-[2-[2-methyl-3-[(3E,7E,11E)-3,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl]oxiran-2-yl]ethyl]oxirane (PubChem CID 87695084) has the molecular formula C30H50O2 and a molecular weight of 442.73 g/mol. Its IUPAC name is 2,2-dimethyl-3-[2-[2-methyl-3-[(3E,7E,11E)-3,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl]oxiran-2-yl]ethyl]oxirane.
| Compound Name | 2,2-dimethyl-3-[2-[2-methyl-3-[(3E,7E,11E)-3,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl]oxiran-2-yl]ethyl]oxirane |
|---|---|
| PubChem CID | 87695084 |
| Molecular Formula | C30H50O2 |
| Molecular Weight | 442.73 g/mol |
| Exact Mass | 442.38 |
| IUPAC Name | 2,2-dimethyl-3-[2-[2-methyl-3-[(3E,7E,11E)-3,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl]oxiran-2-yl]ethyl]oxirane |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C=C(\C)CCC1OC1(C)CCC1OC1(C)C |
| InChI | InChI=1S/C30H50O2/c1-23(2)13-11-16-25(4)18-12-17-24(3)14-9-10-15-26(5)19-20-28-30(8,32-28)22-21-27-29(6,7)31-27/h13-15,18,27-28H,9-12,16-17,19-22H2,1-8H3/b24-14+,25-18+,26-15+ |
| InChIKey | BKFGQWBGDSLFQW-IEYWHCGYSA-N |
| XLogP | 9.03 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.73 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|