About 6-chloro-4-[(1R)-1-methoxypropoxy]pyrido[3,2-d]pyrimidin-2-amine
6-chloro-4-[(1R)-1-methoxypropoxy]pyrido[3,2-d]pyrimidin-2-amine (PubChem CID 87695392) has the molecular formula C11H13ClN4O2
and a molecular weight of 268.70 g/mol. Its IUPAC name is 6-chloro-4-[(1R)-1-methoxypropoxy]pyrido[3,2-d]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 6-chloro-4-[(1R)-1-methoxypropoxy]pyrido[3,2-d]pyrimidin-2-amine |
| PubChem CID | 87695392 |
| Molecular Formula | C11H13ClN4O2 |
| Molecular Weight | 268.70 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 6-chloro-4-[(1R)-1-methoxypropoxy]pyrido[3,2-d]pyrimidin-2-amine |
| SMILES | CC[C@H](OC)Oc1nc(N)nc2ccc(Cl)nc12 |
| InChI | InChI=1S/C11H13ClN4O2/c1-3-8(17-2)18-10-9-6(14-11(13)16-10)4-5-7(12)15-9/h4-5,8H,3H2,1-2H3,(H2,13,14,16)/t8-/m1/s1 |
| InChIKey | HBVLFVYTDMOHFF-MRVPVSSYSA-N |
| XLogP | 2.02 |
| TPSA | 83.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.70 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-4-[(1R)-1-methoxypropoxy]pyrido[3,2-d]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-4-[(1R)-1-methoxypropoxy]pyrido[3,2-d]pyrimidin-2-amine?
The IUPAC name of 6-chloro-4-[(1R)-1-methoxypropoxy]pyrido[3,2-d]pyrimidin-2-amine (CID 87695392) is 6-chloro-4-[(1R)-1-methoxypropoxy]pyrido[3,2-d]pyrimidin-2-amine.
What is the SMILES notation for 6-chloro-4-[(1R)-1-methoxypropoxy]pyrido[3,2-d]pyrimidin-2-amine?
The canonical SMILES for 6-chloro-4-[(1R)-1-methoxypropoxy]pyrido[3,2-d]pyrimidin-2-amine is CC[C@H](OC)Oc1nc(N)nc2ccc(Cl)nc12.
What is the InChIKey of 6-chloro-4-[(1R)-1-methoxypropoxy]pyrido[3,2-d]pyrimidin-2-amine?
The InChIKey is HBVLFVYTDMOHFF-MRVPVSSYSA-N. The full InChI is InChI=1S/C11H13ClN4O2/c1-3-8(17-2)18-10-9-6(14-11(13)16-10)4-5-7(12)15-9/h4-5,8H,3H2,1-2H3,(H2,13,14,16)/t8-/m1/s1.
What are the key properties of 6-chloro-4-[(1R)-1-methoxypropoxy]pyrido[3,2-d]pyrimidin-2-amine?
6-chloro-4-[(1R)-1-methoxypropoxy]pyrido[3,2-d]pyrimidin-2-amine has a molecular weight of 268.70 g/mol, XLogP of 2.02, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-4-[(1R)-1-methoxypropoxy]pyrido[3,2-d]pyrimidin-2-amine is sourced from PubChem (CID 87695392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).