About 2,5-dihydroxy-6-methylidenecyclohexa-1,3-diene-1-sulfonic acid
2,5-dihydroxy-6-methylidenecyclohexa-1,3-diene-1-sulfonic acid (PubChem CID 87696287) has the molecular formula C7H8O5S
and a molecular weight of 204.20 g/mol. Its IUPAC name is 2,5-dihydroxy-6-methylidenecyclohexa-1,3-diene-1-sulfonic acid.
Molecular Properties
| Compound Name | 2,5-dihydroxy-6-methylidenecyclohexa-1,3-diene-1-sulfonic acid |
| PubChem CID | 87696287 |
| Molecular Formula | C7H8O5S |
| Molecular Weight | 204.20 g/mol |
| Exact Mass | 204.01 |
| IUPAC Name | 2,5-dihydroxy-6-methylidenecyclohexa-1,3-diene-1-sulfonic acid |
| SMILES | C=C1C(S(=O)(=O)O)=C(O)C=CC1O |
| InChI | InChI=1S/C7H8O5S/c1-4-5(8)2-3-6(9)7(4)13(10,11)12/h2-3,5,8-9H,1H2,(H,10,11,12) |
| InChIKey | QMRMYDSLIDNSKM-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.20 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dihydroxy-6-methylidenecyclohexa-1,3-diene-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dihydroxy-6-methylidenecyclohexa-1,3-diene-1-sulfonic acid?
The IUPAC name of 2,5-dihydroxy-6-methylidenecyclohexa-1,3-diene-1-sulfonic acid (CID 87696287) is 2,5-dihydroxy-6-methylidenecyclohexa-1,3-diene-1-sulfonic acid.
What is the SMILES notation for 2,5-dihydroxy-6-methylidenecyclohexa-1,3-diene-1-sulfonic acid?
The canonical SMILES for 2,5-dihydroxy-6-methylidenecyclohexa-1,3-diene-1-sulfonic acid is C=C1C(S(=O)(=O)O)=C(O)C=CC1O.
What is the InChIKey of 2,5-dihydroxy-6-methylidenecyclohexa-1,3-diene-1-sulfonic acid?
The InChIKey is QMRMYDSLIDNSKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O5S/c1-4-5(8)2-3-6(9)7(4)13(10,11)12/h2-3,5,8-9H,1H2,(H,10,11,12).
What are the key properties of 2,5-dihydroxy-6-methylidenecyclohexa-1,3-diene-1-sulfonic acid?
2,5-dihydroxy-6-methylidenecyclohexa-1,3-diene-1-sulfonic acid has a molecular weight of 204.20 g/mol, XLogP of 0.13, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dihydroxy-6-methylidenecyclohexa-1,3-diene-1-sulfonic acid is sourced from PubChem (CID 87696287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).