C16H16F3N3O2 — CID 87696312
2,2,2-trifluoro-N-[3-(6-phenylmethoxypyridazin-3-yl)propyl]acetamide (PubChem CID 87696312) has the molecular formula C16H16F3N3O2 and a molecular weight of 339.32 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[3-(6-phenylmethoxypyridazin-3-yl)propyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[3-(6-phenylmethoxypyridazin-3-yl)propyl]acetamide |
|---|---|
| PubChem CID | 87696312 |
| Molecular Formula | C16H16F3N3O2 |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 2,2,2-trifluoro-N-[3-(6-phenylmethoxypyridazin-3-yl)propyl]acetamide |
| SMILES | O=C(NCCCc1ccc(OCc2ccccc2)nn1)C(F)(F)F |
| InChI | InChI=1S/C16H16F3N3O2/c17-16(18,19)15(23)20-10-4-7-13-8-9-14(22-21-13)24-11-12-5-2-1-3-6-12/h1-3,5-6,8-9H,4,7,10-11H2,(H,20,23) |
| InChIKey | VANCPTCWVSVHSU-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|