C11H27N3O3S — CID 87696538
2-aminoethanesulfonic acid;N-methyl-1-propan-2-ylpiperidin-4-amine (PubChem CID 87696538) has the molecular formula C11H27N3O3S and a molecular weight of 281.42 g/mol. Its IUPAC name is 2-aminoethanesulfonic acid;N-methyl-1-propan-2-ylpiperidin-4-amine.
| Compound Name | 2-aminoethanesulfonic acid;N-methyl-1-propan-2-ylpiperidin-4-amine |
|---|---|
| PubChem CID | 87696538 |
| Molecular Formula | C11H27N3O3S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | 2-aminoethanesulfonic acid;N-methyl-1-propan-2-ylpiperidin-4-amine |
| SMILES | CNC1CCN(C(C)C)CC1.NCCS(=O)(=O)O |
| InChI | InChI=1S/C9H20N2.C2H7NO3S/c1-8(2)11-6-4-9(10-3)5-7-11;3-1-2-7(4,5)6/h8-10H,4-7H2,1-3H3;1-3H2,(H,4,5,6) |
| InChIKey | ODMZKSQYJBBROY-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|