C44H30Br8N8+4 — CID 87696848
2,3,7,8,12,13,21,23-octabromo-5,10,15,20-tetrakis(1-methylpyridin-1-ium-4-yl)porphyrin (PubChem CID 87696848) has the molecular formula C44H30Br8N8+4 and a molecular weight of 1310.01 g/mol. Its IUPAC name is 2,3,7,8,12,13,21,23-octabromo-5,10,15,20-tetrakis(1-methylpyridin-1-ium-4-yl)porphyrin.
| Compound Name | 2,3,7,8,12,13,21,23-octabromo-5,10,15,20-tetrakis(1-methylpyridin-1-ium-4-yl)porphyrin |
|---|---|
| PubChem CID | 87696848 |
| Molecular Formula | C44H30Br8N8+4 |
| Molecular Weight | 1310.01 g/mol |
| Exact Mass | 1301.60 |
| IUPAC Name | 2,3,7,8,12,13,21,23-octabromo-5,10,15,20-tetrakis(1-methylpyridin-1-ium-4-yl)porphyrin |
| SMILES | C[n+]1ccc(-c2c3nc(c(-c4cc[n+](C)cc4)c4c(Br)c(Br)c(c(-c5cc[n+](C)cc5)c5nc(c(-c6cc[n+](C)cc6)c6c(Br)c(Br)c2n6Br)C(Br)=C5Br)n4Br)C=C3)cc1 |
| InChI | InChI=1S/C44H30Br8N8/c1-55-15-7-23(8-16-55)29-27-5-6-28(53-27)30(24-9-17-56(2)18-10-24)42-36(48)38(50)44(60(42)52)32(26-13-21-58(4)22-14-26)40-34(46)33(45)39(54-40)31(25-11-19-57(3)20-12-25)43-37(49)35(47)41(29)59(43)51/h5-22H,1-4H3/q+4/b29-27-,30-28-,39-31-,40-32-,41-29-,42-30-,43-31-,44-32- |
| InChIKey | BEYNVUQVGFEKJM-NYMCLJJISA-N |
| XLogP | 12.38 |
| TPSA | 51.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1310.01 |
| LogP ≤ 5 | 12.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|