C28H32ClF3N4O3S — CID 87697584
6-(4-chlorophenyl)-3-(methoxymethyl)-5-[4-(3,3,3-trifluoropropoxy)phenyl]pyrazine-2-carbothioic S-acid;cyclohexane-1,3-diamine (PubChem CID 87697584) has the molecular formula C28H32ClF3N4O3S and a molecular weight of 597.10 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-3-(methoxymethyl)-5-[4-(3,3,3-trifluoropropoxy)phenyl]pyrazine-2-carbothioic S-acid;cyclohexane-1,3-diamine.
| Compound Name | 6-(4-chlorophenyl)-3-(methoxymethyl)-5-[4-(3,3,3-trifluoropropoxy)phenyl]pyrazine-2-carbothioic S-acid;cyclohexane-1,3-diamine |
|---|---|
| PubChem CID | 87697584 |
| Molecular Formula | C28H32ClF3N4O3S |
| Molecular Weight | 597.10 g/mol |
| Exact Mass | 596.18 |
| IUPAC Name | 6-(4-chlorophenyl)-3-(methoxymethyl)-5-[4-(3,3,3-trifluoropropoxy)phenyl]pyrazine-2-carbothioic S-acid;cyclohexane-1,3-diamine |
| SMILES | COCc1nc(-c2ccc(OCCC(F)(F)F)cc2)c(-c2ccc(Cl)cc2)nc1C(=O)S.NC1CCCC(N)C1 |
| InChI | InChI=1S/C22H18ClF3N2O3S.C6H14N2/c1-30-12-17-20(21(29)32)28-19(13-2-6-15(23)7-3-13)18(27-17)14-4-8-16(9-5-14)31-11-10-22(24,25)26;7-5-2-1-3-6(8)4-5/h2-9H,10-12H2,1H3,(H,29,32);5-6H,1-4,7-8H2 |
| InChIKey | DZBFXDOZWXZIPL-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 113.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.10 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|