C28H15N9O5 — CID 87697602
[(Z)-(3-carbamoyl-2-cyanoindeno[1,2-b]pyrazin-9-ylidene)amino] acetate;2-cyano-9-oxoindeno[1,2-b]pyrazine-3-carboxamide (PubChem CID 87697602) has the molecular formula C28H15N9O5 and a molecular weight of 557.49 g/mol. Its IUPAC name is [(Z)-(3-carbamoyl-2-cyanoindeno[1,2-b]pyrazin-9-ylidene)amino] acetate;2-cyano-9-oxoindeno[1,2-b]pyrazine-3-carboxamide.
| Compound Name | [(Z)-(3-carbamoyl-2-cyanoindeno[1,2-b]pyrazin-9-ylidene)amino] acetate;2-cyano-9-oxoindeno[1,2-b]pyrazine-3-carboxamide |
|---|---|
| PubChem CID | 87697602 |
| Molecular Formula | C28H15N9O5 |
| Molecular Weight | 557.49 g/mol |
| Exact Mass | 557.12 |
| IUPAC Name | [(Z)-(3-carbamoyl-2-cyanoindeno[1,2-b]pyrazin-9-ylidene)amino] acetate;2-cyano-9-oxoindeno[1,2-b]pyrazine-3-carboxamide |
| SMILES | CC(=O)O/N=C1/c2ccccc2-c2nc(C(N)=O)c(C#N)nc21.N#Cc1nc2c(nc1C(N)=O)-c1ccccc1C2=O |
| InChI | InChI=1S/C15H9N5O3.C13H6N4O2/c1-7(21)23-20-12-9-5-3-2-4-8(9)11-14(12)18-10(6-16)13(19-11)15(17)22;14-5-8-10(13(15)19)17-9-6-3-1-2-4-7(6)12(18)11(9)16-8/h2-5H,1H3,(H2,17,22);1-4H,(H2,15,19)/b20-12-; |
| InChIKey | CAHPKYXWWKWLSA-GRWWMUSUSA-N |
| XLogP | 1.40 |
| TPSA | 241.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.49 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|