C20H34O — CID 87697974
(2E,4E)-2-methyl-1-[(2E,4E)-2-methylnona-2,4-dienoxy]nona-2,4-diene (PubChem CID 87697974) has the molecular formula C20H34O and a molecular weight of 290.49 g/mol. Its IUPAC name is (2E,4E)-2-methyl-1-[(2E,4E)-2-methylnona-2,4-dienoxy]nona-2,4-diene.
| Compound Name | (2E,4E)-2-methyl-1-[(2E,4E)-2-methylnona-2,4-dienoxy]nona-2,4-diene |
|---|---|
| PubChem CID | 87697974 |
| Molecular Formula | C20H34O |
| Molecular Weight | 290.49 g/mol |
| Exact Mass | 290.26 |
| IUPAC Name | (2E,4E)-2-methyl-1-[(2E,4E)-2-methylnona-2,4-dienoxy]nona-2,4-diene |
| SMILES | CCCC/C=C/C=C(\C)COC/C(C)=C/C=C/CCCC |
| InChI | InChI=1S/C20H34O/c1-5-7-9-11-13-15-19(3)17-21-18-20(4)16-14-12-10-8-6-2/h11-16H,5-10,17-18H2,1-4H3/b13-11+,14-12+,19-15+,20-16+ |
| InChIKey | UYZLASKZWKFGSG-QUQNRITQSA-N |
| XLogP | 6.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.49 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|