About 9-[(1-hydroxy-2,5-dioxopyrrolidin-3-yl)methyl]-9H-fluorene-2-sulfonic acid
9-[(1-hydroxy-2,5-dioxopyrrolidin-3-yl)methyl]-9H-fluorene-2-sulfonic acid (PubChem CID 87698831) has the molecular formula C18H15NO6S
and a molecular weight of 373.39 g/mol. Its IUPAC name is 9-[(1-hydroxy-2,5-dioxopyrrolidin-3-yl)methyl]-9H-fluorene-2-sulfonic acid.
Molecular Properties
| Compound Name | 9-[(1-hydroxy-2,5-dioxopyrrolidin-3-yl)methyl]-9H-fluorene-2-sulfonic acid |
| PubChem CID | 87698831 |
| Molecular Formula | C18H15NO6S |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | 9-[(1-hydroxy-2,5-dioxopyrrolidin-3-yl)methyl]-9H-fluorene-2-sulfonic acid |
| SMILES | O=C1CC(CC2c3ccccc3-c3ccc(S(=O)(=O)O)cc32)C(=O)N1O |
| InChI | InChI=1S/C18H15NO6S/c20-17-8-10(18(21)19(17)22)7-15-13-4-2-1-3-12(13)14-6-5-11(9-16(14)15)26(23,24)25/h1-6,9-10,15,22H,7-8H2,(H,23,24,25) |
| InChIKey | DTVYPWIPFAOFJU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 9-[(1-hydroxy-2,5-dioxopyrrolidin-3-yl)methyl]-9H-fluorene-2-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[(1-hydroxy-2,5-dioxopyrrolidin-3-yl)methyl]-9H-fluorene-2-sulfonic acid?
The IUPAC name of 9-[(1-hydroxy-2,5-dioxopyrrolidin-3-yl)methyl]-9H-fluorene-2-sulfonic acid (CID 87698831) is 9-[(1-hydroxy-2,5-dioxopyrrolidin-3-yl)methyl]-9H-fluorene-2-sulfonic acid.
What is the SMILES notation for 9-[(1-hydroxy-2,5-dioxopyrrolidin-3-yl)methyl]-9H-fluorene-2-sulfonic acid?
The canonical SMILES for 9-[(1-hydroxy-2,5-dioxopyrrolidin-3-yl)methyl]-9H-fluorene-2-sulfonic acid is O=C1CC(CC2c3ccccc3-c3ccc(S(=O)(=O)O)cc32)C(=O)N1O.
What is the InChIKey of 9-[(1-hydroxy-2,5-dioxopyrrolidin-3-yl)methyl]-9H-fluorene-2-sulfonic acid?
The InChIKey is DTVYPWIPFAOFJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO6S/c20-17-8-10(18(21)19(17)22)7-15-13-4-2-1-3-12(13)14-6-5-11(9-16(14)15)26(23,24)25/h1-6,9-10,15,22H,7-8H2,(H,23,24,25).
What are the key properties of 9-[(1-hydroxy-2,5-dioxopyrrolidin-3-yl)methyl]-9H-fluorene-2-sulfonic acid?
9-[(1-hydroxy-2,5-dioxopyrrolidin-3-yl)methyl]-9H-fluorene-2-sulfonic acid has a molecular weight of 373.39 g/mol, XLogP of 2.20, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[(1-hydroxy-2,5-dioxopyrrolidin-3-yl)methyl]-9H-fluorene-2-sulfonic acid is sourced from PubChem (CID 87698831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).