C15F26O3 — CID 87699187
[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[[1,3,4,4,5,6,6,7,8,8,9,9,10,10-tetradecafluoro-2-(trifluoromethyl)-2-adamantyl]oxy]ethoxy]ethyl] hypofluorite (PubChem CID 87699187) has the molecular formula C15F26O3 and a molecular weight of 722.11 g/mol. Its IUPAC name is [1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[[1,3,4,4,5,6,6,7,8,8,9,9,10,10-tetradecafluoro-2-(trifluoromethyl)-2-adamantyl]oxy]ethoxy]ethyl] hypofluorite.
| Compound Name | [1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[[1,3,4,4,5,6,6,7,8,8,9,9,10,10-tetradecafluoro-2-(trifluoromethyl)-2-adamantyl]oxy]ethoxy]ethyl] hypofluorite |
|---|---|
| PubChem CID | 87699187 |
| Molecular Formula | C15F26O3 |
| Molecular Weight | 722.11 g/mol |
| Exact Mass | 721.94 |
| IUPAC Name | [1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[[1,3,4,4,5,6,6,7,8,8,9,9,10,10-tetradecafluoro-2-(trifluoromethyl)-2-adamantyl]oxy]ethoxy]ethyl] hypofluorite |
| SMILES | FOC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC1(C(F)(F)F)C2(F)C(F)(F)C3(F)C(F)(F)C(F)(C2(F)F)C(F)(F)C1(F)C3(F)F |
| InChI | InChI=1S/C15F26O3/c16-1-5(11(30,31)32,42-12(33,34)13(35,36)43-14(37,38)15(39,40)44-41)2(17)8(24,25)3(18,6(1,20)21)10(28,29)4(19,7(1,22)23)9(2,26)27 |
| InChIKey | RKZRNLZTHVPKJE-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.11 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|